Difference between revisions of "1.3.99.23-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] == * smiles: ** C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N)) * inchi key...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.3.99.23-RXN 1.3.99.23-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** carotenoid_isomeras...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUEUINE QUEUINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.3.99.23-RXN 1.3.99.23-RXN] ==
−
* smiles:
+
* direction:
−
** C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O
+
 
* common name:
 
* common name:
−
** queuine
+
** carotenoid_isomerase
−
* molecular weight:
+
** carotene_isomerase
−
** 278.29   
+
** fad_nad_-binding_oxidoreductase_domain-containing_protein
 +
** carotenoid_isomerase-like_protein
 +
** all-trans-_-dihydroretinol_saturase
 +
** ORF
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.3.99.23 EC-1.3.99.23]
 
* Synonym(s):
 
* Synonym(s):
−
** 7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine
 
−
** base Q
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[CPD-13524]][c] '''+''' 1 [[Donor-H2]][c] '''=>''' 1 [[CPD-7247]][c] '''+''' 1 [[Acceptor]][c]
−
* [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]]
+
* With common name(s):
 +
** 1 all-trans-retinol[c] '''+''' 1 a reduced electron acceptor[c] '''=>''' 1 all-trans-13,14-dihydroretinol[c] '''+''' 1 an oxidized electron acceptor[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_3092]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_13367]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_9534]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_16795]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_917]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_13369]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_16794]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289319 86289319]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19193 19193]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77674 77674]
+
** [http://www.genome.jp/dbget-bin/www_bget?R07163 R07163]
−
* HMDB : HMDB01495
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: smiles=C([N+]C1(C=CC(O)C(O)1))C2(=CNC3(N=C(NC(=O)C2=3)N))}}
+
{{#set: common name=carotenoid_isomerase}}
−
{{#set: inchi key=InChIKey=WYROLENTHWJFLR-ACLDMZEESA-O}}
+
{{#set: common name=carotene_isomerase}}
−
{{#set: common name=queuine}}
+
{{#set: common name=fad_nad_-binding_oxidoreductase_domain-containing_protein}}
−
{{#set: molecular weight=278.29    }}
+
{{#set: common name=carotenoid_isomerase-like_protein}}
−
{{#set: common name=7-(3,4-trans-4,5-cis-dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanine|base Q}}
+
{{#set: common name=all-trans-_-dihydroretinol_saturase}}
−
{{#set: reversible reaction associated=QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN}}
+
{{#set: common name=ORF}}
 +
{{#set: ec number=EC-1.3.99.23}}
 +
{{#set: gene associated=Tiso_gene_3092|Tiso_gene_13367|Tiso_gene_9534|Tiso_gene_16795|Tiso_gene_917|Tiso_gene_13369|Tiso_gene_16794}}
 +
{{#set: in pathway=}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-in-silico_annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 20:12, 21 March 2018

Reaction 1.3.99.23-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • carotenoid_isomerase
    • carotene_isomerase
    • fad_nad_-binding_oxidoreductase_domain-containing_protein
    • carotenoid_isomerase-like_protein
    • all-trans-_-dihydroretinol_saturase
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 all-trans-retinol[c] + 1 a reduced electron acceptor[c] => 1 all-trans-13,14-dihydroretinol[c] + 1 an oxidized electron acceptor[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links







Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=1.3.99.23-RXN&oldid=46798"