Difference between revisions of "TRANSENOYLCOARED-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19487 CPD-19487] == * smiles: ** CSCCCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIK...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANSENOYLCOARED-RXN TRANSENOYLCOARED-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http:/...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANSENOYLCOARED-RXN TRANSENOYLCOARED-RXN] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.3.1.38 EC-1.3.1.38] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[NADPH]][c] '''+''' 1 [[TRANS-D2-ENOYL-COA]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[Saturated-Fatty-Acyl-CoA]][c] '''+''' 1 [[NADP]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1 NADPH[c] '''+''' 1 a trans-2-enoyl-CoA[c] '''+''' 1 H+[c] '''=>''' 1 a 2,3,4-saturated fatty acyl CoA[c] '''+''' 1 NADP+[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_18041]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | * Gene: [[Tiso_gene_18040]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | * Gene: [[Tiso_gene_10337]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-RXN: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07162 R07162] |
| − | {{#set: | + | * UNIPROT: |
| − | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q53865 Q53865] |
| − | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | {{#set: | + | {{#set: ec number=EC-1.3.1.38}} |
| + | {{#set: gene associated=Tiso_gene_18041|Tiso_gene_18040|Tiso_gene_10337}} | ||
| + | {{#set: in pathway=}} | ||
| + | {{#set: reconstruction category=orthology}} | ||
| + | {{#set: reconstruction source=orthology-esiliculosus}} | ||
| + | {{#set: reconstruction tool=pantograph}} | ||
Latest revision as of 20:12, 21 March 2018
Contents
Reaction TRANSENOYLCOARED-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NADPH[c] + 1 TRANS-D2-ENOYL-COA[c] + 1 PROTON[c] => 1 Saturated-Fatty-Acyl-CoA[c] + 1 NADP[c]
- With common name(s):
- 1 NADPH[c] + 1 a trans-2-enoyl-CoA[c] + 1 H+[c] => 1 a 2,3,4-saturated fatty acyl CoA[c] + 1 NADP+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_18041
- Source: orthology-esiliculosus
- Gene: Tiso_gene_18040
- Source: orthology-esiliculosus
- Gene: Tiso_gene_10337
- Source: orthology-esiliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links
