Difference between revisions of "Tiso gene 11850"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE THIAMINE] == * smiles: ** CC1([N+](=CSC(CCO)=1)CC2(C=NC(C)=NC(N)=2)) * inchi key: ** I...") |
(Created page with "Category:Gene == Gene Tiso_gene_11850 == * right end position: ** 7441 * transcription direction: ** NEGATIVE * left end position: ** 5768 * centisome position: ** 77.1019...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_11850 == |
− | * | + | * right end position: |
− | ** | + | ** 7441 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 5768 |
− | * | + | * centisome position: |
− | ** | + | ** 77.10199 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[2.1.1.143-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | + | * Reaction: [[RXN-4021]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | ** Source: [[orthology-athaliana]] |
− | * [[ | + | == Pathways associated == |
+ | * [[PWY-2541]] | ||
+ | * [[PWY-7155]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=7441}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=5768}} | |
− | + | {{#set: centisome position=77.10199 }} | |
− | + | {{#set: reaction associated=2.1.1.143-RXN|RXN-4021}} | |
− | + | {{#set: pathway associated=PWY-2541|PWY-7155}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + |
Latest revision as of 20:12, 21 March 2018
Gene Tiso_gene_11850
- right end position:
- 7441
- transcription direction:
- NEGATIVE
- left end position:
- 5768
- centisome position:
- 77.10199
- Synonym(s):
Reactions associated
- Reaction: 2.1.1.143-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: RXN-4021
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: orthology-athaliana
- Source: annotation-in-silico_annotation