Difference between revisions of "Tiso gene 1593"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPYL-ALCOHOL SINAPYL-ALCOHOL] == * smiles: ** COC1(C=C(C=CCO)C=C(OC)C(O)=1) * inchi key: **...") |
(Created page with "Category:Gene == Gene Tiso_gene_1593 == * right end position: ** 22747 * transcription direction: ** POSITIVE * left end position: ** 15922 * centisome position: ** 69.099...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_1593 == |
− | * | + | * right end position: |
− | ** | + | ** 22747 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 15922 |
− | * | + | * centisome position: |
− | ** | + | ** 69.0999 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RXN-15556]] | |
− | * [[RXN- | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: ec-number |
+ | * Reaction: [[UBIQUITIN--PROTEIN-LIGASE-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7511]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=22747}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=15922}} | |
− | + | {{#set: centisome position=69.0999 }} | |
− | + | {{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-7511}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:12, 21 March 2018
Gene Tiso_gene_1593
- right end position:
- 22747
- transcription direction:
- POSITIVE
- left end position:
- 15922
- centisome position:
- 69.0999
- Synonym(s):
Reactions associated
- Reaction: RXN-15556
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: UBIQUITIN--PROTEIN-LIGASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation