Difference between revisions of "TRNA-Containing-N2-Methylguanine-26"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19490 CPD-19490] == * smiles: ** CSCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-N2-Methylguanine-26 tRNA-Containing-N2-Methylguanine-26] == * common name: ** a...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-N2-Methylguanine-26 tRNA-Containing-N2-Methylguanine-26] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** an N2-methylguanine26 in tRNA |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12376]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-12375]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=an N2-methylguanine26 in tRNA}} | |
| − | + | {{#set: consumed by=RXN-12376}} | |
| − | {{#set: common name= | + | {{#set: produced by=RXN-12375}} |
| − | + | ||
| − | {{#set: consumed by=RXN- | + | |
| − | {{#set: | + | |
Latest revision as of 20:12, 21 March 2018
Contents
Metabolite tRNA-Containing-N2-Methylguanine-26
- common name:
- an N2-methylguanine26 in tRNA
- Synonym(s):
