Difference between revisions of "Tiso gene 17880"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9451 CPD-9451] == * smiles: ** CC(C(C(=O)[O-])=CC(=O)[O-])C * inchi key: ** InChIKey=NJMGRJ...")
(Created page with "Category:Gene == Gene Tiso_gene_17880 == * right end position: ** 2493 * transcription direction: ** POSITIVE * left end position: ** 211 * centisome position: ** 6.200411...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9451 CPD-9451] ==
+
== Gene Tiso_gene_17880 ==
−
* smiles:
+
* right end position:
−
** CC(C(C(=O)[O-])=CC(=O)[O-])C
+
** 2493
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NJMGRJLQRLFQQX-HYXAFXHYSA-L
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 2-isopropylmaleate
+
** 211
−
* molecular weight:
+
* centisome position:
−
** 156.138    
+
** 6.2004113    
 
* Synonym(s):
 
* Synonym(s):
−
** β-isopropylmaleate
 
−
** 2-isopropylmaleic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[2.4.2.31-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[3-ISOPROPYLMALISOM-RXN]]
+
*** Assignment: ec-number
−
* [[RXN-8991]]
+
* Reaction: [[3.5.1.98-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2493}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21954611 21954611]
+
{{#set: transcription direction=POSITIVE}}
−
* HMDB : HMDB12241
+
{{#set: left end position=211}}
−
* LIGAND-CPD:
+
{{#set: centisome position=6.2004113   }}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02631 C02631]
+
{{#set: reaction associated=2.4.2.31-RXN|3.5.1.98-RXN}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.10710392.html 10710392]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58085 58085]
+
−
* BIGG : 2ippm
+
−
{{#set: smiles=CC(C(C(=O)[O-])=CC(=O)[O-])C}}
+
−
{{#set: inchi key=InChIKey=NJMGRJLQRLFQQX-HYXAFXHYSA-L}}
+
−
{{#set: common name=2-isopropylmaleate}}
+
−
{{#set: molecular weight=156.138   }}
+
−
{{#set: common name=β-isopropylmaleate|2-isopropylmaleic acid}}
+
−
{{#set: reversible reaction associated=3-ISOPROPYLMALISOM-RXN|RXN-8991}}
+

Latest revision as of 20:12, 21 March 2018

Gene Tiso_gene_17880

  • right end position:
    • 2493
  • transcription direction:
    • POSITIVE
  • left end position:
    • 211
  • centisome position:
    • 6.2004113
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_17880&oldid=46837"