Difference between revisions of "Tiso gene 14816"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7078 CPD-7078] == * smiles: ** C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C...")
(Created page with "Category:Gene == Gene Tiso_gene_14816 == * right end position: ** 4989 * transcription direction: ** POSITIVE * left end position: ** 1405 * centisome position: ** 25.9752...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7078 CPD-7078] ==
+
== Gene Tiso_gene_14816 ==
−
* smiles:
+
* right end position:
−
** C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C(O)C(O)C(O)4))O
+
** 4989
−
* inchi key:
+
* transcription direction:
−
** InChIKey=MVMSCBBUIHUTGJ-HVMPVDAASA-L
+
** POSITIVE
−
* common name:
+
* left end position:
−
** GDP-β-L-gulose
+
** 1405
−
* molecular weight:
+
* centisome position:
−
** 603.329    
+
** 25.975227    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ATPASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-7772]]
+
*** Assignment: ec-number
−
* [[RXN-7771]]
+
* Reaction: [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12195]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12196]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-5462]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7184]]
 +
* [[PWY-7198]]
 +
* [[PWY-6545]]
 +
* [[PWY-7210]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=4989}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657274 90657274]
+
{{#set: transcription direction=POSITIVE}}
−
* LIGAND-CPD:
+
{{#set: left end position=1405}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15925 C15925]
+
{{#set: centisome position=25.975227   }}
−
{{#set: smiles=C(C4(OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))))C(O)C(O)C(O)4))O}}
+
{{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}}
−
{{#set: inchi key=InChIKey=MVMSCBBUIHUTGJ-HVMPVDAASA-L}}
+
{{#set: pathway associated=PWY-7184|PWY-7198|PWY-6545|PWY-7210}}
−
{{#set: common name=GDP-β-L-gulose}}
+
−
{{#set: molecular weight=603.329   }}
+
−
{{#set: reversible reaction associated=RXN-7772|RXN-7771}}
+

Latest revision as of 20:12, 21 March 2018

Gene Tiso_gene_14816

  • right end position:
    • 4989
  • transcription direction:
    • POSITIVE
  • left end position:
    • 1405
  • centisome position:
    • 25.975227
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_14816&oldid=46852"