Difference between revisions of "RXN-12377"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=VANILLIN VANILLIN] == * smiles: ** COC1(C(=CC=C([CH]=O)C=1)O) * inchi key: ** InChIKey=MWOOGOJB...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12377 RXN-12377] == * direction: ** LEFT-TO-RIGHT * common name: ** trna_(guanine_-n1)-methyltr...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12377 RXN-12377] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** trna_(guanine_-n1)-methyltransferase |
− | * | + | ** probable_trna_(guanine_-n_)-dimethyltransferase_1 |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/2.1.1.216 EC-2.1.1.216] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[Guanine26-in-tRNA]][c] '''+''' 2 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[tRNA-Containing-N2-dimethylguanine-26]][c] '''+''' 2 [[PROTON]][c] '''+''' 2 [[ADENOSYL-HOMO-CYS]][c] |
− | == | + | * With common name(s): |
+ | ** 1 a guanine26 in tRNA[c] '''+''' 2 S-adenosyl-L-methionine[c] '''=>''' 1 an N2dimethylguanine26 in tRNA[c] '''+''' 2 H+[c] '''+''' 2 S-adenosyl-L-homocysteine[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_16307]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_9360]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=trna_(guanine_-n1)-methyltransferase}} | |
− | + | {{#set: common name=probable_trna_(guanine_-n_)-dimethyltransferase_1}} | |
− | + | {{#set: ec number=EC-2.1.1.216}} | |
− | + | {{#set: gene associated=Tiso_gene_16307|Tiso_gene_9360}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:12, 21 March 2018
Contents
Reaction RXN-12377
- direction:
- LEFT-TO-RIGHT
- common name:
- trna_(guanine_-n1)-methyltransferase
- probable_trna_(guanine_-n_)-dimethyltransferase_1
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Guanine26-in-tRNA[c] + 2 S-ADENOSYLMETHIONINE[c] => 1 tRNA-Containing-N2-dimethylguanine-26[c] + 2 PROTON[c] + 2 ADENOSYL-HOMO-CYS[c]
- With common name(s):
- 1 a guanine26 in tRNA[c] + 2 S-adenosyl-L-methionine[c] => 1 an N2dimethylguanine26 in tRNA[c] + 2 H+[c] + 2 S-adenosyl-L-homocysteine[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_16307
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_9360
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation