Difference between revisions of "RXN-10862"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETO-ADIPATE 3-KETO-ADIPATE] == * smiles: ** C(=O)([O-])CC(=O)CCC(=O)[O-] * inchi key: ** InC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10862 RXN-10862] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * ec number: ** [http:/...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETO-ADIPATE 3-KETO-ADIPATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10862 RXN-10862] ==
* smiles:
+
* direction:
** C(=O)([O-])CC(=O)CCC(=O)[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=RTGHRDFWYQHVFW-UHFFFAOYSA-L
+
 
* common name:
 
* common name:
** 3-oxoadipate
+
** ORF
* molecular weight:
+
* ec number:
** 158.11   
+
** [http://enzyme.expasy.org/EC/3.6.1.5 EC-3.6.1.5]
 
* Synonym(s):
 
* Synonym(s):
** β-ketoadipate
 
** 3-ketoadipate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[3-OXOADIPATE-ENOL-LACTONASE-RXN]]
+
** 1 [[ADP]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[AMP]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 ADP[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 H+[c] '''+''' 1 AMP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_12899]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_20236]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* UM-BBD-CPD : c0100
+
* LIGAND-RXN:
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R00122 R00122]
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459800 5459800]
+
{{#set: direction=LEFT-TO-RIGHT}}
* HMDB : HMDB00398
+
{{#set: common name=ORF}}
* LIGAND-CPD:
+
{{#set: ec number=EC-3.6.1.5}}
** [http://www.genome.jp/dbget-bin/www_bget?C00846 C00846]
+
{{#set: gene associated=Tiso_gene_12899|Tiso_gene_20236}}
* CHEMSPIDER:
+
{{#set: in pathway=}}
** [http://www.chemspider.com/Chemical-Structure.4573571.html 4573571]
+
{{#set: reconstruction category=orthology|annotation}}
* CHEBI:
+
{{#set: reconstruction source=annotation-experimental_annotation|orthology-athaliana|annotation-in-silico_annotation|orthology-esiliculosus}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15775 15775]
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
{{#set: smiles=C(=O)([O-])CC(=O)CCC(=O)[O-]}}
+
{{#set: inchi key=InChIKey=RTGHRDFWYQHVFW-UHFFFAOYSA-L}}
+
{{#set: common name=3-oxoadipate}}
+
{{#set: molecular weight=158.11    }}
+
{{#set: common name=β-ketoadipate|3-ketoadipate}}
+
{{#set: produced by=3-OXOADIPATE-ENOL-LACTONASE-RXN}}
+

Latest revision as of 21:12, 21 March 2018

Reaction RXN-10862

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 ADP[c] + 1 H2O[c] => 1 phosphate[c] + 1 H+[c] + 1 AMP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links