Difference between revisions of "L-Glutaminyl-Peptides"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17815 CPD-17815] == * smiles: ** CCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-Glutaminyl-Peptides L-Glutaminyl-Peptides] == * common name: ** an N-terminal L-glutaminyl-[p...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17815 CPD-17815] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-Glutaminyl-Peptides L-Glutaminyl-Peptides] ==
* smiles:
+
** CCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=LGTVDWICXIBIOI-UBPKJMQESA-J
+
 
* common name:
 
* common name:
** (11Z)-3-oxo-hexadecenoyl-CoA
+
** an N-terminal L-glutaminyl-[protein]
* molecular weight:
+
** 1013.883   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a [protein] N-terminal L-glutamine
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16561]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16559]]
+
* [[RXN-17893]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an N-terminal L-glutaminyl-[protein]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289728 86289728]
+
{{#set: common name=a [protein] N-terminal L-glutamine}}
* CHEBI:
+
{{#set: produced by=RXN-17893}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=79021 79021]
+
{{#set: smiles=CCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=LGTVDWICXIBIOI-UBPKJMQESA-J}}
+
{{#set: common name=(11Z)-3-oxo-hexadecenoyl-CoA}}
+
{{#set: molecular weight=1013.883    }}
+
{{#set: consumed by=RXN-16561}}
+
{{#set: produced by=RXN-16559}}
+

Latest revision as of 20:12, 21 March 2018

Metabolite L-Glutaminyl-Peptides

  • common name:
    • an N-terminal L-glutaminyl-[protein]
  • Synonym(s):
    • a [protein] N-terminal L-glutamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an N-terminal L-glutaminyl-[protein" cannot be used as a page name in this wiki.
"a [protein] N-terminal L-glutamine" cannot be used as a page name in this wiki.