Difference between revisions of "DGTD"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17701 CPD-17701] == * smiles: ** C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(OS([...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DGTD DGTD] == * direction: ** LEFT-TO-RIGHT * common name: ** 2'-Deoxyguanosine 5'-triphosphate dip...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17701 CPD-17701] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DGTD DGTD] ==
* smiles:
+
* direction:
** C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(OS([O-])(=O)=O)C(O)C=C(C([O-])=O)O2))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=LRPGJWKAYQRIAQ-NODFLXBDSA-J
+
 
* common name:
 
* common name:
** 4-deoxy-2-O-sulfo-β-L-erythro-hex-4-enopyranuronosyl-(1,4)-D-N-sulfoglucosamine 6-O-sulfate
+
** 2'-Deoxyguanosine 5'-triphosphate diphosphohydrolase
* molecular weight:
+
** 573.426   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-16483]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[WATER]][c] '''+''' 1.0 [[DGTP]][c] '''=>''' 1.0 [[PROTON]][c] '''+''' 1.0 [[DGMP]][c] '''+''' 1.0 [[PPI]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 H2O[c] '''+''' 1.0 dGTP[c] '''=>''' 1.0 H+[c] '''+''' 1.0 dGMP[c] '''+''' 1.0 diphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_18793]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820214 91820214]
+
{{#set: common name=2'-Deoxyguanosine 5'-triphosphate diphosphohydrolase}}
{{#set: smiles=C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(OS([O-])(=O)=O)C(O)C=C(C([O-])=O)O2))}}
+
{{#set: gene associated=Tiso_gene_18793}}
{{#set: inchi key=InChIKey=LRPGJWKAYQRIAQ-NODFLXBDSA-J}}
+
{{#set: in pathway=}}
{{#set: common name=4-deoxy-2-O-sulfo-β-L-erythro-hex-4-enopyranuronosyl-(1,4)-D-N-sulfoglucosamine 6-O-sulfate}}
+
{{#set: reconstruction category=orthology}}
{{#set: molecular weight=573.426    }}
+
{{#set: reconstruction source=orthology-creinhardtii}}
{{#set: consumed by=RXN-16483}}
+
{{#set: reconstruction tool=pantograph}}

Latest revision as of 20:13, 21 March 2018

Reaction DGTD

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 2'-Deoxyguanosine 5'-triphosphate diphosphohydrolase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 H2O[c] + 1.0 dGTP[c] => 1.0 H+[c] + 1.0 dGMP[c] + 1.0 diphosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links