Difference between revisions of "HACD5m"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBOXYMETHYL-HYDROXYPHENYLPROPCOA CARBOXYMETHYL-HYDROXYPHENYLPROPCOA] == * smiles: ** CC(C)(C(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HACD5m HACD5m] == * direction: ** REVERSIBLE * common name: ** 3-hydroxyacyl-CoA dehydrogenase (C12...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBOXYMETHYL-HYDROXYPHENYLPROPCOA CARBOXYMETHYL-HYDROXYPHENYLPROPCOA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=HACD5m HACD5m] ==
−
* smiles:
+
* direction:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C(CC([O-])=O)C(O)C1(=CC=CC=C1))=O)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=DVSQFPLMOLPRDU-ACXVELPGSA-I
+
 
* common name:
 
* common name:
−
** 2-carboxymethyl-3-hydroxyphenylpropanoyl-CoA
+
** 3-hydroxyacyl-CoA dehydrogenase (C12:0)
−
* molecular weight:
+
−
** 968.692   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (hydroxymethylphenyl)succinyl-CoA
 
−
** 2-carboxymethyl-3-hydroxyphenylpropionyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-905]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[NADH]][m] '''+''' 1.0 [[PROTON]][m] '''+''' 1.0 [[CPD0-2105]][m] '''<=>''' 1.0 [[CPD0-2107]][m] '''+''' 1.0 [[NAD]][m]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 NADH[m] '''+''' 1.0 H+[m] '''+''' 1.0 3-oxododecanoyl-CoA[m] '''<=>''' 1.0 (S)-3-hydroxydodecanoyl-CoA[m] '''+''' 1.0 NAD+[m]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_5857]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658758 90658758]
+
{{#set: common name=3-hydroxyacyl-CoA dehydrogenase (C12:0)}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_5857}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28202 28202]
+
{{#set: in pathway=}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C09819 C09819]
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
* HMDB : HMDB12145
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C(CC([O-])=O)C(O)C1(=CC=CC=C1))=O)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=DVSQFPLMOLPRDU-ACXVELPGSA-I}}
+
−
{{#set: common name=2-carboxymethyl-3-hydroxyphenylpropanoyl-CoA}}
+
−
{{#set: molecular weight=968.692    }}
+
−
{{#set: common name=(hydroxymethylphenyl)succinyl-CoA|2-carboxymethyl-3-hydroxyphenylpropionyl-CoA}}
+
−
{{#set: consumed by=RXN-905}}
+

Latest revision as of 20:13, 21 March 2018

Reaction HACD5m

  • direction:
    • REVERSIBLE
  • common name:
    • 3-hydroxyacyl-CoA dehydrogenase (C12:0)
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 NADH[m] + 1.0 H+[m] + 1.0 3-oxododecanoyl-CoA[m] <=> 1.0 (S)-3-hydroxydodecanoyl-CoA[m] + 1.0 NAD+[m]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=HACD5m&oldid=46870"