Difference between revisions of "Tiso gene 4976"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL-1P MANNITOL-1P] == * smiles: ** C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O * inchi key: **...")
(Created page with "Category:Gene == Gene Tiso_gene_4976 == * right end position: ** 14013 * transcription direction: ** NEGATIVE * left end position: ** 8336 * centisome position: ** 59.1835...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL-1P MANNITOL-1P] ==
+
== Gene Tiso_gene_4976 ==
−
* smiles:
+
* right end position:
−
** C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O
+
** 14013
−
* inchi key:
+
* transcription direction:
−
** InChIKey=GACTWZZMVMUKNG-KVTDHHQDSA-L
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** D-mannitol 1-phosphate
+
** 8336
−
* molecular weight:
+
* centisome position:
−
** 260.137    
+
** 59.183525    
 
* Synonym(s):
 
* Synonym(s):
−
** mannitol-1-P
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[MANNITOL-1-PHOSPHATASE-RXN]]
+
* Reaction: [[6.3.4.16-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[CARBPSYN-RXN]]
−
* [[MANNPDEHYDROG-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[GLUTAMIN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-13202]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14196]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16909]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16910]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-4984]]
 +
* [[GLUTAMINDEG-PWY]]
 +
* [[ARGSYN-PWY]]
 +
* [[PWY-5154]]
 +
* [[PWY-7400]]
 +
* [[ARGSYNBSUB-PWY]]
 +
* [[PWY-7693]]
 +
* [[PWY-7790]]
 +
* [[PWY-7791]]
 +
* [[PWY-5686]]
 +
* [[CITRULBIO-PWY]]
 
== External links  ==
 
== External links  ==
−
* CAS : 15806-48-1
+
{{#set: right end position=14013}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615341 23615341]
+
{{#set: left end position=8336}}
−
* HMDB : HMDB01530
+
{{#set: centisome position=59.183525   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=6.3.4.16-RXN|CARBPSYN-RXN|GLUTAMIN-RXN|RXN-13202|RXN-14196|RXN-16909|RXN-16910}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00644 C00644]
+
{{#set: pathway associated=PWY-4984|GLUTAMINDEG-PWY|ARGSYN-PWY|PWY-5154|PWY-7400|ARGSYNBSUB-PWY|PWY-7693|PWY-7790|PWY-7791|PWY-5686|CITRULBIO-PWY}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.19951338.html 19951338]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61381 61381]
+
−
* BIGG : mnl1p
+
−
{{#set: smiles=C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O}}
+
−
{{#set: inchi key=InChIKey=GACTWZZMVMUKNG-KVTDHHQDSA-L}}
+
−
{{#set: common name=D-mannitol 1-phosphate}}
+
−
{{#set: molecular weight=260.137   }}
+
−
{{#set: common name=mannitol-1-P}}
+
−
{{#set: consumed by=MANNITOL-1-PHOSPHATASE-RXN}}
+
−
{{#set: reversible reaction associated=MANNPDEHYDROG-RXN}}
+

Latest revision as of 21:13, 21 March 2018

Gene Tiso_gene_4976

  • right end position:
    • 14013
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 8336
  • centisome position:
    • 59.183525
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_4976&oldid=46877"