Difference between revisions of "RXN-17203"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11402 CPD-11402] == * smiles: ** C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17203 RXN-17203] == * direction: ** REVERSIBLE * common name: ** galactose-3-o-sulfotransferase...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11402 CPD-11402] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17203 RXN-17203] ==
* smiles:
+
* direction:
** C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C=C3)))
+
** REVERSIBLE
* inchi key:
+
** InChIKey=LQMBVWCQWFEPFK-DKBYMCRTSA-M
+
 
* common name:
 
* common name:
** 3,5,3'-triiodo-L-thyronine acyl β-D-glucuronide
+
** galactose-3-o-sulfotransferase_2-like
* molecular weight:
+
* ec number:
** 826.095   
+
** [http://enzyme.expasy.org/EC/2.8.2.11 EC-2.8.2.11]
 
* Synonym(s):
 
* Synonym(s):
** 3,5,3'-triiodothyronine acyl β-D-glucuronide
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-10609]]
+
** 1 [[PAPS]][c] '''+''' 1 [[1-Alkyl-2-acyl-3D-galactosyl-sn-glycerol]][c] '''<=>''' 1 [[3-5-ADP]][c] '''+''' 1 [[Seminolipids]][c] '''+''' 1 [[PROTON]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 3'-phosphoadenylyl-sulfate[c] '''+''' 1 a 1-O-alkyl-2-O-acyl-3-O-&beta;-D-galactosyl-sn-glycerol[c] '''<=>''' 1 adenosine 3',5'-bisphosphate[c] '''+''' 1 a seminolipid[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_13030]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659330 90659330]
+
{{#set: common name=galactose-3-o-sulfotransferase_2-like}}
{{#set: smiles=C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C=C3)))}}
+
{{#set: ec number=EC-2.8.2.11}}
{{#set: inchi key=InChIKey=LQMBVWCQWFEPFK-DKBYMCRTSA-M}}
+
{{#set: gene associated=Tiso_gene_13030}}
{{#set: common name=3,5,3'-triiodo-L-thyronine acyl &beta;-D-glucuronide}}
+
{{#set: in pathway=}}
{{#set: molecular weight=826.095    }}
+
{{#set: reconstruction category=annotation}}
{{#set: common name=3,5,3'-triiodothyronine acyl &beta;-D-glucuronide}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
{{#set: produced by=RXN-10609}}
+
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 20:13, 21 March 2018

Reaction RXN-17203

  • direction:
    • REVERSIBLE
  • common name:
    • galactose-3-o-sulfotransferase_2-like
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links