Difference between revisions of "AKGCITtm"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-RIBAZOLE ALPHA-RIBAZOLE] == * smiles: ** CC2(C(C)=CC1(N(C=NC=1C=2)C3(C(O)C(O)C(CO)O3))) *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AKGCITtm AKGCITtm] == * direction: ** REVERSIBLE * common name: ** Dicarboxylate/tricarboxylate car...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AKGCITtm AKGCITtm] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** Dicarboxylate/tricarboxylate carrier (akg:cit), mitochondrial |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 1.0 [[CIT]][m] '''+''' 1.0 [[2-KETOGLUTARATE]][c] '''<=>''' 1.0 [[CIT]][c] '''+''' 1.0 [[2-KETOGLUTARATE]][m] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1.0 citrate[m] '''+''' 1.0 2-oxoglutarate[c] '''<=>''' 1.0 citrate[c] '''+''' 1.0 2-oxoglutarate[m] |
| − | * [[ | + | |
| − | * [[ | + | == Genes associated with this reaction == |
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_14857]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: common name=Dicarboxylate/tricarboxylate carrier (akg:cit), mitochondrial}} | |
| − | + | {{#set: gene associated=Tiso_gene_14857}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:13, 21 March 2018
Contents
Reaction AKGCITtm
- direction:
- REVERSIBLE
- common name:
- Dicarboxylate/tricarboxylate carrier (akg:cit), mitochondrial
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 CIT[m] + 1.0 2-KETOGLUTARATE[c] <=> 1.0 CIT[c] + 1.0 2-KETOGLUTARATE[m]
- With common name(s):
- 1.0 citrate[m] + 1.0 2-oxoglutarate[c] <=> 1.0 citrate[c] + 1.0 2-oxoglutarate[m]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_14857
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii
