Difference between revisions of "1-2-Diglycerides"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Z-PHYCOERYTHROBILIN 3Z-PHYCOERYTHROBILIN] == * smiles: ** CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-2-Diglycerides 1-2-Diglycerides] == * common name: ** a 1,2-diglyceride * Synonym(s): ** a 1,...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Z-PHYCOERYTHROBILIN 3Z-PHYCOERYTHROBILIN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-2-Diglycerides 1-2-Diglycerides] ==
* smiles:
+
** CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)
+
* inchi key:
+
** InChIKey=IGJXAXFFKKRFKU-ISRBKNAYSA-L
+
 
* common name:
 
* common name:
** (3Z)-phycoerythrobilin
+
** a 1,2-diglyceride
* molecular weight:
+
** 584.671   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a 1,2-diacylglycerol
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-1602]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.3.7.3-RXN]]
+
* [[TRIACYLGLYCEROL-LIPASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a 1,2-diglyceride}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820182 91820182]
+
{{#set: common name=a 1,2-diacylglycerol}}
* CHEBI:
+
{{#set: consumed by=RXN-1602}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57438 57438]
+
{{#set: produced by=TRIACYLGLYCEROL-LIPASE-RXN}}
{{#set: smiles=CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)}}
+
{{#set: inchi key=InChIKey=IGJXAXFFKKRFKU-ISRBKNAYSA-L}}
+
{{#set: common name=(3Z)-phycoerythrobilin}}
+
{{#set: molecular weight=584.671    }}
+
{{#set: produced by=1.3.7.3-RXN}}
+

Latest revision as of 20:13, 21 March 2018

Metabolite 1-2-Diglycerides

  • common name:
    • a 1,2-diglyceride
  • Synonym(s):
    • a 1,2-diacylglycerol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links