Difference between revisions of "Tiso gene 17498"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15895 CPD-15895] == * smiles: ** [CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O * inchi key: ** InCh...")
(Created page with "Category:Gene == Gene Tiso_gene_17498 == * right end position: ** 2404 * transcription direction: ** POSITIVE * left end position: ** 515 * centisome position: ** 14.06335...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15895 CPD-15895] ==
+
== Gene Tiso_gene_17498 ==
−
* smiles:
+
* right end position:
−
** [CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O
+
** 2404
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PPQRONHOSHZGFQ-LMVFSUKVSA-L
+
** POSITIVE
−
* common name:
+
* left end position:
−
** aldehydo-D-ribose 5-phosphate
+
** 515
−
* molecular weight:
+
* centisome position:
−
** 228.095    
+
** 14.063354    
 
* Synonym(s):
 
* Synonym(s):
−
** keto-D-ribose 5-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.1.13.4-RXN]]
−
* [[RXN-15346]]
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-14997]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2404}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21115541 21115541]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=515}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58273 58273]
+
{{#set: centisome position=14.063354   }}
−
{{#set: smiles=[CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O}}
+
{{#set: reaction associated=3.1.13.4-RXN}}
−
{{#set: inchi key=InChIKey=PPQRONHOSHZGFQ-LMVFSUKVSA-L}}
+
−
{{#set: common name=aldehydo-D-ribose 5-phosphate}}
+
−
{{#set: molecular weight=228.095   }}
+
−
{{#set: common name=keto-D-ribose 5-phosphate}}
+
−
{{#set: produced by=RXN-15346|RXN-14997}}
+

Latest revision as of 20:13, 21 March 2018

Gene Tiso_gene_17498

  • right end position:
    • 2404
  • transcription direction:
    • POSITIVE
  • left end position:
    • 515
  • centisome position:
    • 14.063354
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_17498&oldid=46898"