Difference between revisions of "OBTUSIFOLIOL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THREO-DS-ISO-CITRATE THREO-DS-ISO-CITRATE] == * smiles: ** C(=O)(C(CC([O-])=O)C(O)C([O-])=O)[O-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OBTUSIFOLIOL OBTUSIFOLIOL] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OBTUSIFOLIOL OBTUSIFOLIOL] == |
* smiles: | * smiles: | ||
| − | ** C(= | + | ** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34)))) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** obtusifoliol |
| + | * inchi key: | ||
| + | ** InChIKey=MMNYKQIDRZNIKT-VSADUBDNSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 426.724 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 4α,14α-dimethyl-5α-ergosta-8,24(28)-dien-3β-ol |
| − | + | ** 4α,14α-dimethyl-24-methylene-5α-cholesta-8-en-3β-ol | |
| − | ** | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[OBFOOLor]] | ||
| + | * [[1.14.13.70-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[CYCLOEUCALENOL-CYCLOISOMERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=65252 65252] |
| − | + | * HMDB : HMDB01242 | |
| − | * HMDB : | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17791 17791] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles=C(= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01943 C01943] |
| − | {{#set: | + | {{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}} |
| − | {{#set: | + | {{#set: common name=obtusifoliol}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=MMNYKQIDRZNIKT-VSADUBDNSA-N}} |
| − | {{#set: common name= | + | {{#set: molecular weight=426.724 }} |
| − | {{#set: | + | {{#set: common name=4α,14α-dimethyl-5α-ergosta-8,24(28)-dien-3β-ol|4α,14α-dimethyl-24-methylene-5α-cholesta-8-en-3β-ol}} |
| + | {{#set: consumed by=OBFOOLor|1.14.13.70-RXN}} | ||
| + | {{#set: produced by=CYCLOEUCALENOL-CYCLOISOMERASE-RXN}} | ||
Latest revision as of 20:13, 21 March 2018
Contents
Metabolite OBTUSIFOLIOL
- smiles:
- CC(C)C(=C)CCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
- common name:
- obtusifoliol
- inchi key:
- InChIKey=MMNYKQIDRZNIKT-VSADUBDNSA-N
- molecular weight:
- 426.724
- Synonym(s):
- 4α,14α-dimethyl-5α-ergosta-8,24(28)-dien-3β-ol
- 4α,14α-dimethyl-24-methylene-5α-cholesta-8-en-3β-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(=C)CCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.
