Difference between revisions of "CPD-731"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] == * smiles: ** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O * inchi key: *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-731 CPD-731] == * smiles: ** CCC=CCC1(C(=O)CCC1CC([O-])=O) * common name: ** (+)-7-iso-jasm...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-731 CPD-731] == |
* smiles: | * smiles: | ||
− | ** | + | ** CCC=CCC1(C(=O)CCC1CC([O-])=O) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** (+)-7-iso-jasmonate |
+ | * inchi key: | ||
+ | ** InChIKey=ZNJFBWYDHIGLCU-QKMQQOOLSA-M | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 209.264 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** (+)-7-iso-jasmonic acid |
− | ** | + | ** iso-jasmonic acid |
− | + | ** (3R,7S)-(+)-7-iso-jasmonate | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-10708]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | * | + | * LIPID_MAPS : LMFA02020003 |
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7251182 7251182] |
− | {{#set: smiles= | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.5584838.html 5584838] |
− | {{#set: | + | * CHEBI: |
− | {{#set: molecular weight= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18435 18435] |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16317 C16317] |
+ | {{#set: smiles=CCC=CCC1(C(=O)CCC1CC([O-])=O)}} | ||
+ | {{#set: common name=(+)-7-iso-jasmonate}} | ||
+ | {{#set: inchi key=InChIKey=ZNJFBWYDHIGLCU-QKMQQOOLSA-M}} | ||
+ | {{#set: molecular weight=209.264 }} | ||
+ | {{#set: common name=(+)-7-iso-jasmonic acid|iso-jasmonic acid|(3R,7S)-(+)-7-iso-jasmonate}} | ||
+ | {{#set: produced by=RXN-10708}} |
Latest revision as of 21:13, 21 March 2018
Contents
Metabolite CPD-731
- smiles:
- CCC=CCC1(C(=O)CCC1CC([O-])=O)
- common name:
- (+)-7-iso-jasmonate
- inchi key:
- InChIKey=ZNJFBWYDHIGLCU-QKMQQOOLSA-M
- molecular weight:
- 209.264
- Synonym(s):
- (+)-7-iso-jasmonic acid
- iso-jasmonic acid
- (3R,7S)-(+)-7-iso-jasmonate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC1(C(=O)CCC1CC([O-])=O)" cannot be used as a page name in this wiki.