Difference between revisions of "Tiso gene 9823"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-511 CPD-511] == * smiles: ** CC(C(O)C(=O)NCCC(NCCS)=O)(C)CO * inchi key: ** InChIKey=ZNXZGR...") |
(Created page with "Category:Gene == Gene Tiso_gene_9823 == * right end position: ** 9001 * transcription direction: ** NEGATIVE * left end position: ** 6352 * centisome position: ** 70.22665...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_9823 == |
− | * | + | * right end position: |
− | ** | + | ** 9001 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 6352 |
− | * | + | * centisome position: |
− | ** | + | ** 70.22665 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[UDPGLUCEPIM-RXN]] | |
− | == | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[UG4E]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-3821]] | ||
+ | * [[PWY-6397]] | ||
+ | * [[PWY-6317]] | ||
+ | * [[PWY-6527]] | ||
+ | * [[PWY-7328]] | ||
+ | * [[COLANSYN-PWY]] | ||
+ | * [[PWY66-422]] | ||
+ | * [[PWY-7344]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=9001}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=6352}} | |
− | + | {{#set: centisome position=70.22665 }} | |
− | + | {{#set: reaction associated=UDPGLUCEPIM-RXN|UG4E}} | |
− | + | {{#set: pathway associated=PWY-3821|PWY-6397|PWY-6317|PWY-6527|PWY-7328|COLANSYN-PWY|PWY66-422|PWY-7344}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:13, 21 March 2018
Gene Tiso_gene_9823
- right end position:
- 9001
- transcription direction:
- NEGATIVE
- left end position:
- 6352
- centisome position:
- 70.22665
- Synonym(s):
Reactions associated
- Reaction: UDPGLUCEPIM-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: UG4E
- Source: orthology-creinhardtii