Difference between revisions of "Tiso gene 3537"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-182 CPD-182] == * smiles: ** CC1(=CC(OC2(C=C(O)C=CC1=2))=O) * inchi key: ** InChIKey=HSHNIT...") |
(Created page with "Category:Gene == Gene Tiso_gene_3537 == * right end position: ** 16204 * transcription direction: ** POSITIVE * left end position: ** 15026 * centisome position: ** 91.055...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_3537 == |
− | * | + | * right end position: |
− | ** | + | ** 16204 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 15026 |
− | * | + | * centisome position: |
− | ** | + | ** 91.05563 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[R4-RXN]] | |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=16204}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=15026}} | |
− | + | {{#set: centisome position=91.05563 }} | |
− | + | {{#set: reaction associated=R4-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:13, 21 March 2018
Gene Tiso_gene_3537
- right end position:
- 16204
- transcription direction:
- POSITIVE
- left end position:
- 15026
- centisome position:
- 91.05563
- Synonym(s):
Reactions associated
- Reaction: R4-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation