Difference between revisions of "DCYTPT"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXYINDOLE DIHYDROXYINDOLE] == * smiles: ** C1(=CNC2(=C1C=C(O)C(O)=C2)) * inchi key: ** In...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DCYTPT DCYTPT] == * direction: ** LEFT-TO-RIGHT * common name: ** ATP:deoxynucleoside 5'-phosphotra...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DCYTPT DCYTPT] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** 5 | + | ** ATP:deoxynucleoside 5'-phosphotransferase |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 1.0 [[ATP]][c] '''+''' 1.0 [[DEOXYCYTIDINE]][c] '''=>''' 1.0 [[PROTON]][c] '''+''' 1.0 [[ADP]][c] '''+''' 1.0 [[DCMP]][c] |
| − | == | + | * With common name(s): |
| + | ** 1.0 ATP[c] '''+''' 1.0 2'-deoxycytidine[c] '''=>''' 1.0 H+[c] '''+''' 1.0 ADP[c] '''+''' 1.0 dCMP[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_416]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=ATP:deoxynucleoside 5'-phosphotransferase}} | |
| − | + | {{#set: gene associated=Tiso_gene_416}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:13, 21 March 2018
Contents
Reaction DCYTPT
- direction:
- LEFT-TO-RIGHT
- common name:
- ATP:deoxynucleoside 5'-phosphotransferase
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 ATP[c] + 1.0 DEOXYCYTIDINE[c] => 1.0 PROTON[c] + 1.0 ADP[c] + 1.0 DCMP[c]
- With common name(s):
- 1.0 ATP[c] + 1.0 2'-deoxycytidine[c] => 1.0 H+[c] + 1.0 ADP[c] + 1.0 dCMP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_416
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii
