Difference between revisions of "CPD-375"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYADIPYL-COA 3-HYDROXYADIPYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC(=O...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-375 CPD-375] == * smiles: ** CC1(=C(C2(=C(C=N1)COC2=O))O) * common name: ** 4-pyridoxolacto...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-375 CPD-375] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC1(=C(C2(=C(C=N1)COC2=O))O) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 4-pyridoxolactone |
+ | * inchi key: | ||
+ | ** InChIKey=HHPDVQLBYQFYFA-UHFFFAOYSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 165.148 |
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[PYRIDOXAL-4-DEHYDROGENASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
− | |||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=151228 151228] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.133287.html 133287] | ||
+ | * HMDB : HMDB03454 | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16871 16871] |
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00971 C00971] |
− | + | {{#set: smiles=CC1(=C(C2(=C(C=N1)COC2=O))O)}} | |
− | {{#set: smiles= | + | {{#set: common name=4-pyridoxolactone}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=HHPDVQLBYQFYFA-UHFFFAOYSA-N}} |
− | {{#set: | + | {{#set: molecular weight=165.148 }} |
− | {{#set: molecular weight= | + | {{#set: produced by=PYRIDOXAL-4-DEHYDROGENASE-RXN}} |
− | {{#set: | + |
Latest revision as of 20:13, 21 March 2018
Contents
Metabolite CPD-375
- smiles:
- CC1(=C(C2(=C(C=N1)COC2=O))O)
- common name:
- 4-pyridoxolactone
- inchi key:
- InChIKey=HHPDVQLBYQFYFA-UHFFFAOYSA-N
- molecular weight:
- 165.148
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links