Difference between revisions of "RXN-905"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NIACINAMIDE NIACINAMIDE] == * smiles: ** C1(N=CC(C(=O)N)=CC=1) * inchi key: ** InChIKey=DFPAKSU...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-905 RXN-905] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-hydroxyacyl-_dehydrogenase **...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NIACINAMIDE NIACINAMIDE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-905 RXN-905] ==
−
* smiles:
+
* direction:
−
** C1(N=CC(C(=O)N)=CC=1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=DFPAKSUCGFBDDF-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** nicotinamide
+
** 3-hydroxyacyl-_dehydrogenase
−
* molecular weight:
+
** hydroxyacyl-coenzyme_a_dehydrogenase_3-ketoacyl-coenzyme_a_thiolase_enoyl-coenzyme_a_hydratasealpha_subunit
−
** 122.126   
+
** hydroxyacyl-coenzyme_a_mitochondrial
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.1.1.35 EC-1.1.1.35]
 
* Synonym(s):
 
* Synonym(s):
−
** 6-aminonicotinamide
 
−
** vitamin PP
 
−
** niacinamide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[2.4.2.12-RXN]]
+
* With identifiers:
−
* [[NICOTINAMIDE-N-METHYLTRANSFERASE-RXN]]
+
** 1 [[CARBOXYMETHYL-HYDROXYPHENYLPROPCOA]][c] '''+''' 1 [[NAD]][c] '''=>''' 1 [[NADH]][c] '''+''' 1 [[BENZOYLSUCCINYL-COA]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[R313-RXN]]
+
** 1 2-carboxymethyl-3-hydroxyphenylpropanoyl-CoA[c] '''+''' 1 NAD+[c] '''=>''' 1 NADH[c] '''+''' 1 benzoylsuccinyl-CoA[c] '''+''' 1 H+[c]
−
* [[2.7.1.160-RXN]]
+
 
−
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
−
* [[2.4.2.31-RXN]]
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]]
+
* Gene: [[Tiso_gene_18839]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_14026]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_18838]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_14262]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_5857]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-81]], toluene degradation to benzoyl-CoA (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-81 PWY-81]
 +
** '''1''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 98-92-0
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* METABOLIGHTS : MTBLC17154
+
{{#set: common name=3-hydroxyacyl-_dehydrogenase}}
−
* DRUGBANK : DB02701
+
{{#set: common name=hydroxyacyl-coenzyme_a_dehydrogenase_3-ketoacyl-coenzyme_a_thiolase_enoyl-coenzyme_a_hydratasealpha_subunit}}
−
* PUBCHEM:
+
{{#set: common name=hydroxyacyl-coenzyme_a_mitochondrial}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=936 936]
+
{{#set: ec number=EC-1.1.1.35}}
−
* KNAPSACK : C00000209
+
{{#set: gene associated=Tiso_gene_18839|Tiso_gene_14026|Tiso_gene_18838|Tiso_gene_14262|Tiso_gene_5857}}
−
* HMDB : HMDB01406
+
{{#set: in pathway=PWY-81}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00153 C00153]
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
−
* CHEMSPIDER:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.chemspider.com/Chemical-Structure.911.html 911]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17154 17154]
+
−
* BIGG : ncam
+
−
{{#set: smiles=C1(N=CC(C(=O)N)=CC=1)}}
+
−
{{#set: inchi key=InChIKey=DFPAKSUCGFBDDF-UHFFFAOYSA-N}}
+
−
{{#set: common name=nicotinamide}}
+
−
{{#set: molecular weight=122.126    }}
+
−
{{#set: common name=6-aminonicotinamide|vitamin PP|niacinamide}}
+
−
{{#set: consumed by=2.4.2.12-RXN|NICOTINAMIDE-N-METHYLTRANSFERASE-RXN}}
+
−
{{#set: produced by=R313-RXN|2.7.1.160-RXN}}
+
−
{{#set: reversible reaction associated=2.4.2.31-RXN|NAD+-ADP-RIBOSYLTRANSFERASE-RXN}}
+

Latest revision as of 20:13, 21 March 2018

Reaction RXN-905

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-hydroxyacyl-_dehydrogenase
    • hydroxyacyl-coenzyme_a_dehydrogenase_3-ketoacyl-coenzyme_a_thiolase_enoyl-coenzyme_a_hydratasealpha_subunit
    • hydroxyacyl-coenzyme_a_mitochondrial
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-81, toluene degradation to benzoyl-CoA (anaerobic): PWY-81
    • 1 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-905&oldid=46939"