Difference between revisions of "Tiso gene 355"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-THREONINE-O-3-PHOSPHATE L-THREONINE-O-3-PHOSPHATE] == * smiles: ** CC(OP([O-])([O-])=O)C([N+]...")
(Created page with "Category:Gene == Gene Tiso_gene_355 == * right end position: ** 26672 * transcription direction: ** POSITIVE * left end position: ** 302 * centisome position: ** 0.8647101...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-THREONINE-O-3-PHOSPHATE L-THREONINE-O-3-PHOSPHATE] ==
+
== Gene Tiso_gene_355 ==
−
* smiles:
+
* right end position:
−
** CC(OP([O-])([O-])=O)C([N+])C([O-])=O
+
** 26672
−
* inchi key:
+
* transcription direction:
−
** InChIKey=USRGIUJOYOXOQJ-GBXIJSLDSA-L
+
** POSITIVE
−
* common name:
+
* left end position:
−
** L-threonine 3-O-phosphate
+
** 302
−
* molecular weight:
+
* centisome position:
−
** 197.084    
+
** 0.8647101    
 
* Synonym(s):
 
* Synonym(s):
−
** O-phospho-L-threonine
 
−
** phosphothreonine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[NADH-DEHYDROG-A-RXN]]
−
* [[RXN-8626]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-6692]]
 +
* [[PWY-3781]]
 +
* [[PWY-5083]]
 +
* [[PWY0-1334]]
 +
* [[PWY0-1335]]
 +
* [[PWY-4302]]
 
== External links  ==
 
== External links  ==
−
* CAS : 1114-81-4
+
{{#set: right end position=26672}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=36688171 36688171]
+
{{#set: left end position=302}}
−
* HMDB : HMDB11185
+
{{#set: centisome position=0.8647101   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=NADH-DEHYDROG-A-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C12147 C12147]
+
{{#set: pathway associated=PWY-6692|PWY-3781|PWY-5083|PWY0-1334|PWY0-1335|PWY-4302}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58675 58675]
+
−
* BIGG : thrp
+
−
{{#set: smiles=CC(OP([O-])([O-])=O)C([N+])C([O-])=O}}
+
−
{{#set: inchi key=InChIKey=USRGIUJOYOXOQJ-GBXIJSLDSA-L}}
+
−
{{#set: common name=L-threonine 3-O-phosphate}}
+
−
{{#set: molecular weight=197.084   }}
+
−
{{#set: common name=O-phospho-L-threonine|phosphothreonine}}
+
−
{{#set: produced by=RXN-8626}}
+

Latest revision as of 20:13, 21 March 2018

Gene Tiso_gene_355

  • right end position:
    • 26672
  • transcription direction:
    • POSITIVE
  • left end position:
    • 302
  • centisome position:
    • 0.8647101
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_355&oldid=46940"