Difference between revisions of "Ubiquitin-activating-protein-E1-L-cys"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RETINAL RETINAL] == * smiles: ** CC(C=CC1(C(C)(C)CCCC(C)=1))=CC=CC(C)=C[CH]=O * inchi key: ** I...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ubiquitin-activating-protein-E1-L-cys Ubiquitin-activating-protein-E1-L-cys] == * common name:...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RETINAL RETINAL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ubiquitin-activating-protein-E1-L-cys Ubiquitin-activating-protein-E1-L-cys] ==
−
* smiles:
+
−
** CC(C=CC1(C(C)(C)CCCC(C)=1))=CC=CC(C)=C[CH]=O
+
−
* inchi key:
+
−
** InChIKey=NCYCYZXNIZJOKI-OVSJKPMPSA-N
+
 
* common name:
 
* common name:
−
** all-trans-retinal
+
** an [E1 ubiquitin-activating enzyme]-L-cysteine
−
* molecular weight:
+
−
** 284.441   
+
 
* Synonym(s):
 
* Synonym(s):
−
** vitamin A aldehyde
+
** a [ubiquitin-activating enzyme E1]-L-cysteine
−
** retinene
+
−
** axerophthal
+
−
** retinaldehyde
+
−
** retinal
+
−
** all-trans-Vitamin A aldehyde
+
−
** all-trans-retinene
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-13374]]
+
* [[RXN-15563]]
 +
* [[RXN-15556]]
 +
* [[RXN-16314]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[RETINOL-DEHYDROGENASE-RXN]]
 
 
== External links  ==
 
== External links  ==
−
* CAS : 116-31-4
+
{{#set: common name=an [E1 ubiquitin-activating enzyme]-L-cysteine}}
−
* LIPID_MAPS : LMPR01090002
+
{{#set: common name=a [ubiquitin-activating enzyme E1]-L-cysteine}}
−
* PUBCHEM:
+
{{#set: consumed by=UBIQUITIN--PROTEIN-LIGASE-RXN}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=638015 638015]
+
{{#set: produced by=RXN-15563|RXN-15556|RXN-16314}}
−
* HMDB : HMDB01358
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00376 C00376]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.553582.html 553582]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17898 17898]
+
−
* METABOLIGHTS : MTBLC17898
+
−
{{#set: smiles=CC(C=CC1(C(C)(C)CCCC(C)=1))=CC=CC(C)=C[CH]=O}}
+
−
{{#set: inchi key=InChIKey=NCYCYZXNIZJOKI-OVSJKPMPSA-N}}
+
−
{{#set: common name=all-trans-retinal}}
+
−
{{#set: molecular weight=284.441    }}
+
−
{{#set: common name=vitamin A aldehyde|retinene|axerophthal|retinaldehyde|retinal|all-trans-Vitamin A aldehyde|all-trans-retinene}}
+
−
{{#set: produced by=RXN-13374}}
+
−
{{#set: reversible reaction associated=RETINOL-DEHYDROGENASE-RXN}}
+

Latest revision as of 20:13, 21 March 2018

Metabolite Ubiquitin-activating-protein-E1-L-cys

  • common name:
    • an [E1 ubiquitin-activating enzyme]-L-cysteine
  • Synonym(s):
    • a [ubiquitin-activating enzyme E1]-L-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an [E1 ubiquitin-activating enzyme]-L-cysteine" cannot be used as a page name in this wiki.
"a [ubiquitin-activating enzyme E1]-L-cysteine" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Ubiquitin-activating-protein-E1-L-cys&oldid=46941"