Difference between revisions of "Tiso gene 3113"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-OXOBUT AMINO-OXOBUT] == * smiles: ** CC(=O)C([N+])C([O-])=O * inchi key: ** InChIKey=SAUC...")
(Created page with "Category:Gene == Gene Tiso_gene_3113 == * Synonym(s): == Reactions associated == * Reaction: NADH-DEHYDROG-A-RXN ** Source: orthology-esiliculosus * Reaction: N...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-OXOBUT AMINO-OXOBUT] ==
+
== Gene Tiso_gene_3113 ==
−
* smiles:
+
−
** CC(=O)C([N+])C([O-])=O
+
−
* inchi key:
+
−
** InChIKey=SAUCHDKDCUROAO-VKHMYHEASA-N
+
−
* common name:
+
−
** L-2-amino-3-oxobutanoate
+
−
* molecular weight:
+
−
** 117.104   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxothreonine
 
−
** 3-keto-L-threonine
 
−
** L-2-amino-acetoacetate
 
−
** L-2-amino-3-ketobutyrate
 
−
** L-2-amino-3-oxobutyrate
 
−
** α-amino-β-ketobutyrate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[THREOSPON-RXN]]
+
* Reaction: [[NADH-DEHYDROG-A-RXN]]
−
* [[AKBLIG-RXN]]
+
** Source: [[orthology-esiliculosus]]
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[NADHor_2m]]
−
* [[RXN-16000]]
+
** Source: [[orthology-creinhardtii]]
−
* [[THREODEHYD-RXN]]
+
== Pathways associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[PWY-6692]]
 +
* [[PWY-3781]]
 +
* [[PWY-5083]]
 +
* [[PWY0-1334]]
 +
* [[PWY0-1335]]
 +
* [[PWY-4302]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: reaction associated=NADH-DEHYDROG-A-RXN|NADHor_2m}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289686 86289686]
+
{{#set: pathway associated=PWY-6692|PWY-3781|PWY-5083|PWY0-1334|PWY0-1335|PWY-4302}}
−
* HMDB : HMDB06454
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C03508 C03508]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.4573764.html 4573764]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78948 78948]
+
−
* BIGG : 2aobut
+
−
{{#set: smiles=CC(=O)C([N+])C([O-])=O}}
+
−
{{#set: inchi key=InChIKey=SAUCHDKDCUROAO-VKHMYHEASA-N}}
+
−
{{#set: common name=L-2-amino-3-oxobutanoate}}
+
−
{{#set: molecular weight=117.104    }}
+
−
{{#set: common name=3-oxothreonine|3-keto-L-threonine|L-2-amino-acetoacetate|L-2-amino-3-ketobutyrate|L-2-amino-3-oxobutyrate|α-amino-β-ketobutyrate}}
+
−
{{#set: consumed by=THREOSPON-RXN|AKBLIG-RXN}}
+
−
{{#set: produced by=RXN-16000|THREODEHYD-RXN}}
+

Latest revision as of 20:13, 21 March 2018

Gene Tiso_gene_3113

  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_3113&oldid=46946"