Difference between revisions of "RXN-3521"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SACCHAROPINE SACCHAROPINE] == * smiles: ** C(CC[N+]C(CCC([O-])=O)C([O-])=O)CC([N+])C([O-])=O *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-3521 RXN-3521] == * direction: ** LEFT-TO-RIGHT * common name: ** ascorbate_peroxidase * Synony...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-3521 RXN-3521] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** ascorbate_peroxidase |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** L-ascorbic acid peroxidase |
− | ** | + | ** L-ascorbic acid-specific peroxidase |
− | ** | + | ** ascorbic acid peroxidase |
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 2 [[ASCORBATE]][c] '''+''' 2 [[PROTON]][c] '''=>''' 2 [[WATER]][c] '''+''' 2 [[CPD-318]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 hydrogen peroxide[c] '''+''' 2 L-ascorbate[c] '''+''' 2 H+[c] '''=>''' 2 H2O[c] '''+''' 2 monodehydroascorbate radical[c] |
− | == | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_16028]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Tiso_gene_15962]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Tiso_gene_5435]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-2261]], ascorbate glutathione cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2261 PWY-2261] | ||
+ | ** '''2''' reactions found over '''4''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * LIGAND- | + | * RHEA: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30266 30266] |
− | * | + | * LIGAND-RXN: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R09540 R09540] |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00644 R00644] |
− | * | + | * UNIPROT: |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P48534 P48534] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q7M287 Q7M287] |
− | + | ** [http://www.uniprot.org/uniprot/O49159 O49159] | |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q7M3G0 Q7M3G0] |
− | {{#set: common name=L- | + | ** [http://www.uniprot.org/uniprot/Q05431 Q05431] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q43824 Q43824] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q41772 Q41772] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q41371 Q41371] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q42661 Q42661] |
+ | ** [http://www.uniprot.org/uniprot/Q42564 Q42564] | ||
+ | ** [http://www.uniprot.org/uniprot/O46921 O46921] | ||
+ | ** [http://www.uniprot.org/uniprot/P93404 P93404] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9FE01 Q9FE01] | ||
+ | ** [http://www.uniprot.org/uniprot/O65634 O65634] | ||
+ | ** [http://www.uniprot.org/uniprot/Q39843 Q39843] | ||
+ | ** [http://www.uniprot.org/uniprot/O49122 O49122] | ||
+ | ** [http://www.uniprot.org/uniprot/O49822 O49822] | ||
+ | ** [http://www.uniprot.org/uniprot/Q42459 Q42459] | ||
+ | ** [http://www.uniprot.org/uniprot/Q39780 Q39780] | ||
+ | ** [http://www.uniprot.org/uniprot/Q96399 Q96399] | ||
+ | ** [http://www.uniprot.org/uniprot/O81333 O81333] | ||
+ | ** [http://www.uniprot.org/uniprot/O81603 O81603] | ||
+ | ** [http://www.uniprot.org/uniprot/O81604 O81604] | ||
+ | ** [http://www.uniprot.org/uniprot/Q42909 Q42909] | ||
+ | ** [http://www.uniprot.org/uniprot/Q9STM9 Q9STM9] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=ascorbate_peroxidase}} | ||
+ | {{#set: common name=L-ascorbic acid peroxidase|L-ascorbic acid-specific peroxidase|ascorbic acid peroxidase}} | ||
+ | {{#set: gene associated=Tiso_gene_16028|Tiso_gene_15962|Tiso_gene_5435}} | ||
+ | {{#set: in pathway=PWY-2261}} | ||
+ | {{#set: reconstruction category=annotation}} | ||
+ | {{#set: reconstruction source=annotation-in-silico_annotation}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 20:13, 21 March 2018
Contents
Reaction RXN-3521
- direction:
- LEFT-TO-RIGHT
- common name:
- ascorbate_peroxidase
- Synonym(s):
- L-ascorbic acid peroxidase
- L-ascorbic acid-specific peroxidase
- ascorbic acid peroxidase
Reaction Formula
- With identifiers:
- 1 HYDROGEN-PEROXIDE[c] + 2 ASCORBATE[c] + 2 PROTON[c] => 2 WATER[c] + 2 CPD-318[c]
- With common name(s):
- 1 hydrogen peroxide[c] + 2 L-ascorbate[c] + 2 H+[c] => 2 H2O[c] + 2 monodehydroascorbate radical[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_16028
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_15962
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_5435
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
Pathways
- PWY-2261, ascorbate glutathione cycle: PWY-2261
- 2 reactions found over 4 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: