Difference between revisions of "Tiso gene 1537"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10244 CPD-10244] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-] * inchi key: ** InChI...")
(Created page with "Category:Gene == Gene Tiso_gene_1537 == * right end position: ** 1729 * transcription direction: ** POSITIVE * left end position: ** 149 * centisome position: ** 0.6363442...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10244 CPD-10244] ==
+
== Gene Tiso_gene_1537 ==
−
* smiles:
+
* right end position:
−
** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-]
+
** 1729
−
* inchi key:
+
* transcription direction:
−
** InChIKey=MBMBGCFOFBJSGT-KUBAVDMBSA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** docosahexaenoate
+
** 149
−
* molecular weight:
+
* centisome position:
−
** 327.486    
+
** 0.6363442    
 
* Synonym(s):
 
* Synonym(s):
−
** docosahexaenoic acid
 
−
** DHA
 
−
** all-cis-docosa-4,7,10,13,16,19-hexaenoate
 
−
** (4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoate
 
−
** (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.1.1.64-RXN]]
−
* [[RXN-16138]]
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-16017]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-esiliculosus]]
−
* [[RXN-16063]]
+
* Reaction: [[CARBOXYLESTERASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RETINYL-PALMITATE-ESTERASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-10711]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-10767]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-12252]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-12575]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXNQT-4366]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-6857]]
 +
* [[PWY-6303]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMFA01030185
+
{{#set: right end position=1729}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40486925 40486925]
+
{{#set: left end position=149}}
−
* DRUGBANK : DB03756
+
{{#set: centisome position=0.6363442   }}
−
* CHEBI:
+
{{#set: reaction associated=3.1.1.64-RXN|CARBOXYLESTERASE-RXN|RETINYL-PALMITATE-ESTERASE-RXN|RXN-10711|RXN-10767|RXN-12252|RXN-12575|RXNQT-4366}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77016 77016]
+
{{#set: pathway associated=PWY-6857|PWY-6303}}
−
* HMDB : HMDB02183
+
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=MBMBGCFOFBJSGT-KUBAVDMBSA-M}}
+
−
{{#set: common name=docosahexaenoate}}
+
−
{{#set: molecular weight=327.486   }}
+
−
{{#set: common name=docosahexaenoic acid|DHA|all-cis-docosa-4,7,10,13,16,19-hexaenoate|(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoate|(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate}}
+
−
{{#set: produced by=RXN-16138|RXN-16017}}
+
−
{{#set: reversible reaction associated=RXN-16063}}
+

Latest revision as of 20:13, 21 March 2018

Gene Tiso_gene_1537

  • right end position:
    • 1729
  • transcription direction:
    • POSITIVE
  • left end position:
    • 149
  • centisome position:
    • 0.6363442
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_1537&oldid=46973"