Difference between revisions of "PSERTRANSAM-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-I-CIT HOMO-I-CIT] == * smiles: ** C(CC(=O)[O-])C(C(=O)[O-])C(O)C(=O)[O-] * inchi key: ** I...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PSERTRANSAM-RXN PSERTRANSAM-RXN] == * direction: ** REVERSIBLE * common name: ** ORF ** phosphoseri...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PSERTRANSAM-RXN PSERTRANSAM-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** ORF |
− | * | + | ** phosphoserine_aminotransferase |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/2.6.1.52 EC-2.6.1.52] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[3-P-SERINE]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''<=>''' 1 [[GLT]][c] '''+''' 1 [[3-P-HYDROXYPYRUVATE]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 3-phospho-L-serine[c] '''+''' 1 2-oxoglutarate[c] '''<=>''' 1 L-glutamate[c] '''+''' 1 3-phospho-hydroxypyruvate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_17123]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_15686]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[SERSYN-PWY]], L-serine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=SERSYN-PWY SERSYN-PWY] | ||
+ | ** '''3''' reactions found over '''3''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[manual]] | ||
+ | ** Source: [[manual-primary_network]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14329 14329] |
− | * | + | * LIGAND-RXN: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04173 R04173] |
− | * | + | * UNIPROT: |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P10658 P10658] |
− | * | + | ** [http://www.uniprot.org/uniprot/P23721 P23721] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9PIH3 Q9PIH3] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9CHW5 Q9CHW5] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P44336 P44336] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/O34370 O34370] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P62676 P62676] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P33330 P33330] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P19689 P19689] |
+ | {{#set: direction=REVERSIBLE}} | ||
+ | {{#set: common name=ORF}} | ||
+ | {{#set: common name=phosphoserine_aminotransferase}} | ||
+ | {{#set: ec number=EC-2.6.1.52}} | ||
+ | {{#set: gene associated=Tiso_gene_17123|Tiso_gene_15686}} | ||
+ | {{#set: in pathway=SERSYN-PWY}} | ||
+ | {{#set: reconstruction category=orthology|manual|annotation}} | ||
+ | {{#set: reconstruction source=annotation-in-silico_annotation|manual-primary_network|annotation-experimental_annotation|orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 20:13, 21 March 2018
Contents
Reaction PSERTRANSAM-RXN
- direction:
- REVERSIBLE
- common name:
- ORF
- phosphoserine_aminotransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 3-P-SERINE[c] + 1 2-KETOGLUTARATE[c] <=> 1 GLT[c] + 1 3-P-HYDROXYPYRUVATE[c]
- With common name(s):
- 1 3-phospho-L-serine[c] + 1 2-oxoglutarate[c] <=> 1 L-glutamate[c] + 1 3-phospho-hydroxypyruvate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_17123
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_15686
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
Pathways
- SERSYN-PWY, L-serine biosynthesis: SERSYN-PWY
- 3 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: manual
- Source: manual-primary_network
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: