Difference between revisions of "Tiso gene 11795"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC...")
 
(Created page with "Category:Gene == Gene Tiso_gene_11795 == * right end position: ** 6694 * transcription direction: ** POSITIVE * left end position: ** 4568 * centisome position: ** 60.7527...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] ==
+
== Gene Tiso_gene_11795 ==
−
* smiles:
+
* right end position:
−
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** 6694
−
* inchi key:
+
* transcription direction:
−
** InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 24-methylenecholesterol
+
** 4568
−
* molecular weight:
+
* centisome position:
−
** 398.671    
+
** 60.75276    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[GALACTOKIN-RXN]]
−
* [[RXN-707]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-6317]]
 +
* [[PWY66-422]]
 +
* [[PWY-6527]]
 +
* [[PWY-3821]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=6694}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92113 92113]
+
{{#set: transcription direction=POSITIVE}}
−
* LIGAND-CPD:
+
{{#set: left end position=4568}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15781 C15781]
+
{{#set: centisome position=60.75276    }}
−
* HMDB : HMDB06849
+
{{#set: reaction associated=GALACTOKIN-RXN}}
−
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: pathway associated=PWY-6317|PWY66-422|PWY-6527|PWY-3821}}
−
{{#set: inchi key=InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N}}
+
−
{{#set: common name=24-methylenecholesterol}}
+
−
{{#set: molecular weight=398.671    }}
+
−
{{#set: produced by=RXN-707}}
+

Latest revision as of 20:30, 21 March 2018

Gene Tiso_gene_11795

  • right end position:
    • 6694
  • transcription direction:
    • POSITIVE
  • left end position:
    • 4568
  • centisome position:
    • 60.75276
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_11795&oldid=42055"