Difference between revisions of "THIAMINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14419 CPD-14419] == * smiles: ** CCC=CCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE THIAMINE] == * smiles: ** CC1([N+](=CSC(CCO)=1)CC2(C=NC(C)=NC(N)=2)) * common name: **...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE THIAMINE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC1([N+](=CSC(CCO)=1)CC2(C=NC(C)=NC(N)=2)) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** thiamine |
| + | * inchi key: | ||
| + | ** InChIKey=JZRWCGZRTZMZEH-UHFFFAOYSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 265.352 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** thiamin |
| − | ** | + | ** vitamin B1 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[THIAMIN-PYROPHOSPHOKINASE-RXN]] |
| + | * [[TransportSeed_THIAMINE]] | ||
| + | * [[TMDPT]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[TransportSeed_THIAMINE]] |
| + | * [[RXNQT-4191]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[ExchangeSeed_THIAMINE]] | ||
== External links == | == External links == | ||
| + | * CAS : 67-03-8 | ||
| + | * CAS : 59-43-8 | ||
| + | * BIGG : thm | ||
| + | * DRUGBANK : DB00152 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1130 1130] |
| + | * HMDB : HMDB00235 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00378 C00378] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.1098.html 1098] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18385 18385] |
| − | {{#set: smiles= | + | * METABOLIGHTS : MTBLC18385 |
| − | {{#set: | + | {{#set: smiles=CC1([N+](=CSC(CCO)=1)CC2(C=NC(C)=NC(N)=2))}} |
| − | {{#set: | + | {{#set: common name=thiamine}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=JZRWCGZRTZMZEH-UHFFFAOYSA-N}} |
| − | {{#set: common name= | + | {{#set: molecular weight=265.352 }} |
| − | {{#set: consumed by= | + | {{#set: common name=thiamin|vitamin B1}} |
| − | {{#set: produced by= | + | {{#set: consumed by=THIAMIN-PYROPHOSPHOKINASE-RXN|TransportSeed_THIAMINE|TMDPT}} |
| + | {{#set: produced by=TransportSeed_THIAMINE|RXNQT-4191}} | ||
| + | {{#set: reversible reaction associated=ExchangeSeed_THIAMINE}} | ||
Latest revision as of 20:14, 21 March 2018
Contents
Metabolite THIAMINE
- smiles:
- CC1([N+](=CSC(CCO)=1)CC2(C=NC(C)=NC(N)=2))
- common name:
- thiamine
- inchi key:
- InChIKey=JZRWCGZRTZMZEH-UHFFFAOYSA-N
- molecular weight:
- 265.352
- Synonym(s):
- thiamin
- vitamin B1
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 67-03-8
- CAS : 59-43-8
- BIGG : thm
- DRUGBANK : DB00152
- PUBCHEM:
- HMDB : HMDB00235
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC18385
"CC1([N+](=CSC(CCO)=1)CC2(C=NC(C)=NC(N)=2))" cannot be used as a page name in this wiki.
