Difference between revisions of "Tiso gene 15504"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-P ACETYL-P] == * smiles: ** CC(OP([O-])(=O)[O-])=O * inchi key: ** InChIKey=LIPOUNRJVLNB...")
(Created page with "Category:Gene == Gene Tiso_gene_15504 == * right end position: ** 4823 * transcription direction: ** POSITIVE * left end position: ** 162 * centisome position: ** 3.247143...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-P ACETYL-P] ==
+
== Gene Tiso_gene_15504 ==
−
* smiles:
+
* right end position:
−
** CC(OP([O-])(=O)[O-])=O
+
** 4823
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LIPOUNRJVLNBCD-UHFFFAOYSA-L
+
** POSITIVE
−
* common name:
+
* left end position:
−
** acetyl phosphate
+
** 162
−
* molecular weight:
+
* centisome position:
−
** 138.016    
+
** 3.2471437    
 
* Synonym(s):
 
* Synonym(s):
−
** acetyl-P
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[APhi]]
+
* Reaction: [[ALLANTOICASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-5697]]
 
== External links  ==
 
== External links  ==
−
* UM-BBD-CPD : c0049
+
{{#set: right end position=4823}}
−
* CAS : 19926-71-7
+
{{#set: transcription direction=POSITIVE}}
−
* PUBCHEM:
+
{{#set: left end position=162}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4183249 4183249]
+
{{#set: centisome position=3.2471437   }}
−
* HMDB : HMDB01494
+
{{#set: reaction associated=ALLANTOICASE-RXN}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-5697}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00227 C00227]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.3394205.html 3394205]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=22191 22191]
+
−
* BIGG : actp
+
−
{{#set: smiles=CC(OP([O-])(=O)[O-])=O}}
+
−
{{#set: inchi key=InChIKey=LIPOUNRJVLNBCD-UHFFFAOYSA-L}}
+
−
{{#set: common name=acetyl phosphate}}
+
−
{{#set: molecular weight=138.016   }}
+
−
{{#set: common name=acetyl-P}}
+
−
{{#set: consumed by=APhi}}
+

Latest revision as of 20:14, 21 March 2018

Gene Tiso_gene_15504

  • right end position:
    • 4823
  • transcription direction:
    • POSITIVE
  • left end position:
    • 162
  • centisome position:
    • 3.2471437
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_15504&oldid=47009"