Difference between revisions of "Tiso gene 6496"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CONIFERYL-ALCOHOL CONIFERYL-ALCOHOL] == * smiles: ** COC1(=CC(C=CCO)=CC=C(O)1) * inchi key: **...") |
(Created page with "Category:Gene == Gene Tiso_gene_6496 == * right end position: ** 3284 * transcription direction: ** POSITIVE * left end position: ** 2629 * centisome position: ** 21.68247...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_6496 == |
− | * | + | * right end position: |
− | ** | + | ** 3284 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 2629 |
− | * | + | * centisome position: |
− | ** | + | ** 21.682474 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[2.4.1.224-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
+ | == Pathways associated == | ||
+ | * [[PWY-6558]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3284}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=2629}} | |
− | + | {{#set: centisome position=21.682474 }} | |
− | + | {{#set: reaction associated=2.4.1.224-RXN}} | |
− | + | {{#set: pathway associated=PWY-6558}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:14, 21 March 2018
Gene Tiso_gene_6496
- right end position:
- 3284
- transcription direction:
- POSITIVE
- left end position:
- 2629
- centisome position:
- 21.682474
- Synonym(s):
Reactions associated
- Reaction: 2.4.1.224-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation