Difference between revisions of "CPD-535"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17383 CPD-17383] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-535 CPD-535] == * smiles: ** C(C1(OC(C(C1O)O)(CO)OP([O-])([O-])=O))OP(=O)([O-])[O-] * commo...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-535 CPD-535] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(C1(OC(C(C1O)O)(CO)OP([O-])([O-])=O))OP(=O)([O-])[O-] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** β-D-fructose 2,6-bisphosphate |
| + | * inchi key: | ||
| + | ** InChIKey=YXWOAJXNVLXPMU-ZXXMMSQZSA-J | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 336.085 |
* Synonym(s): | * Synonym(s): | ||
| + | ** fru 2,6-P2 | ||
| + | ** fructose 2,6-diphosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3.1.3.46-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[6-PHOSPHOFRUCTO-2-KINASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21117974 21117974] |
| + | * HMDB : HMDB01047 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00665 C00665] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.19975981.html 19975981] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58579 58579] |
| − | {{#set: smiles= | + | * METABOLIGHTS : MTBLC58579 |
| − | {{#set: | + | {{#set: smiles=C(C1(OC(C(C1O)O)(CO)OP([O-])([O-])=O))OP(=O)([O-])[O-]}} |
| − | {{#set: | + | {{#set: common name=β-D-fructose 2,6-bisphosphate}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=YXWOAJXNVLXPMU-ZXXMMSQZSA-J}} |
| − | {{#set: consumed by=RXN | + | {{#set: molecular weight=336.085 }} |
| − | {{#set: produced by= | + | {{#set: common name=fru 2,6-P2|fructose 2,6-diphosphate}} |
| + | {{#set: consumed by=3.1.3.46-RXN}} | ||
| + | {{#set: produced by=6-PHOSPHOFRUCTO-2-KINASE-RXN}} | ||
Latest revision as of 20:14, 21 March 2018
Contents
Metabolite CPD-535
- smiles:
- C(C1(OC(C(C1O)O)(CO)OP([O-])([O-])=O))OP(=O)([O-])[O-]
- common name:
- β-D-fructose 2,6-bisphosphate
- inchi key:
- InChIKey=YXWOAJXNVLXPMU-ZXXMMSQZSA-J
- molecular weight:
- 336.085
- Synonym(s):
- fru 2,6-P2
- fructose 2,6-diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB01047
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC58579
"C(C1(OC(C(C1O)O)(CO)OP([O-])([O-])=O))OP(=O)([O-])[O-" cannot be used as a page name in this wiki.
