Difference between revisions of "RXN-13607"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHO-ENOL-PYRUVATE PHOSPHO-ENOL-PYRUVATE] == * smiles: ** C=C(OP([O-])([O-])=O)C([O-])=O * i...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13607 RXN-13607] == * direction: ** LEFT-TO-RIGHT * common name: ** exostosin_family_protein *...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13607 RXN-13607] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** exostosin_family_protein |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.4.1.17 EC-2.4.1.17] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | + | ** 1 [[UDP-GLUCURONATE]][c] '''+''' 1 [[CPD-14601]][c] '''=>''' 1 [[CPD-14602]][c] '''+''' 1 [[UDP]][c] | |
| − | + | * With common name(s): | |
| − | + | ** 1 UDP-α-D-glucuronate[c] '''+''' 1 mycophenolate[c] '''=>''' 1 mycophenolic acid O-acyl-glucuronide[c] '''+''' 1 UDP[c] | |
| − | + | ||
| − | + | == Genes associated with this reaction == | |
| − | * | + | Genes have been associated with this reaction based on different elements listed below. |
| − | + | * Gene: [[Tiso_gene_14140]] | |
| − | + | ** Source: [[annotation-in-silico_annotation]] | |
| − | == | + | *** Assignment: EC-NUMBER |
| − | * [[ | + | * Gene: [[Tiso_gene_14141]] |
| − | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
| − | * [[ | + | *** Assignment: EC-NUMBER |
| − | * [[ | + | == Pathways == |
| − | * [[ | + | == Reconstruction information == |
| − | * [[ | + | * Category: [[annotation]] |
| − | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=exostosin_family_protein}} | |
| − | + | {{#set: ec number=EC-2.4.1.17}} | |
| − | + | {{#set: gene associated=Tiso_gene_14140|Tiso_gene_14141}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:14, 21 March 2018
Contents
Reaction RXN-13607
- direction:
- LEFT-TO-RIGHT
- common name:
- exostosin_family_protein
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 UDP-GLUCURONATE[c] + 1 CPD-14601[c] => 1 CPD-14602[c] + 1 UDP[c]
- With common name(s):
- 1 UDP-α-D-glucuronate[c] + 1 mycophenolate[c] => 1 mycophenolic acid O-acyl-glucuronide[c] + 1 UDP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_14140
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_14141
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
