Difference between revisions of "Tiso gene 3651"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8563 CPD-8563] == * smiles: ** C(OP(=O)(O)O)C(C(=O)N[R])NC(=O)[R] * common name: ** myosin...") |
(Created page with "Category:Gene == Gene Tiso_gene_3651 == * right end position: ** 9060 * transcription direction: ** NEGATIVE * left end position: ** 2045 * centisome position: ** 12.58539...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_3651 == |
| − | * | + | * right end position: |
| − | ** | + | ** 9060 |
| − | * | + | * transcription direction: |
| − | ** | + | ** NEGATIVE |
| + | * left end position: | ||
| + | ** 2045 | ||
| + | * centisome position: | ||
| + | ** 12.58539 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reactions associated == |
| − | + | * Reaction: [[DNA-DIRECTED-DNA-POLYMERASE-RXN]] | |
| − | + | ** Source: [[annotation-in-silico_annotation]] | |
| − | * [[ | + | *** Assignment: ec-number |
| + | == Pathways associated == | ||
== External links == | == External links == | ||
| − | + | {{#set: right end position=9060}} | |
| − | + | {{#set: transcription direction=NEGATIVE}} | |
| − | {{#set: | + | {{#set: left end position=2045}} |
| − | {{#set: | + | {{#set: centisome position=12.58539 }} |
| − | {{#set: | + | {{#set: reaction associated=DNA-DIRECTED-DNA-POLYMERASE-RXN}} |
Latest revision as of 20:14, 21 March 2018
Gene Tiso_gene_3651
- right end position:
- 9060
- transcription direction:
- NEGATIVE
- left end position:
- 2045
- centisome position:
- 12.58539
- Synonym(s):
Reactions associated
- Reaction: DNA-DIRECTED-DNA-POLYMERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
