Difference between revisions of "NICONUCADENYLYLTRAN-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9923 CPD-9923] == * smiles: ** C1(=CC(O)C(C(=O)[O-])C(=C1)C(=O)CCC(=O)[O-]) * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NICONUCADENYLYLTRAN-RXN NICONUCADENYLYLTRAN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: **...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NICONUCADENYLYLTRAN-RXN NICONUCADENYLYLTRAN-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Probable nicotinate-nucleotide adenylyltransferase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.7.7.18 EC-2.7.7.18] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[ATP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NICOTINATE_NUCLEOTIDE]][c] '''=>''' 1 [[DEAMIDO-NAD]][c] '''+''' 1 [[PPI]][c] |
− | == | + | * With common name(s): |
+ | ** 1 ATP[c] '''+''' 1 H+[c] '''+''' 1 β-nicotinate D-ribonucleotide[c] '''=>''' 1 nicotinate adenine dinucleotide[c] '''+''' 1 diphosphate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_6231]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-5381]], pyridine nucleotide cycling (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5381 PWY-5381] | ||
+ | ** '''3''' reactions found over '''11''' reactions in the full pathway | ||
+ | * [[PWY-5653]], NAD biosynthesis from 2-amino-3-carboxymuconate semialdehyde: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5653 PWY-5653] | ||
+ | ** '''3''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PYRIDNUCSYN-PWY]], NAD biosynthesis I (from aspartate): [http://metacyc.org/META/NEW-IMAGE?object=PYRIDNUCSYN-PWY PYRIDNUCSYN-PWY] | ||
+ | ** '''3''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[PWY-7761]], NAD salvage pathway II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7761 PWY-7761] | ||
+ | ** '''1''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PYRIDNUCSAL-PWY]], NAD salvage pathway I: [http://metacyc.org/META/NEW-IMAGE?object=PYRIDNUCSAL-PWY PYRIDNUCSAL-PWY] | ||
+ | ** '''1''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22860 22860] | |
− | + | * LIGAND-RXN: | |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03005 R03005] |
− | * LIGAND- | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: common name=Probable nicotinate-nucleotide adenylyltransferase}} |
− | {{#set: | + | {{#set: ec number=EC-2.7.7.18}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_6231}} |
− | {{#set: | + | {{#set: in pathway=PWY-5381|PWY-5653|PYRIDNUCSYN-PWY|PWY-7761|PYRIDNUCSAL-PWY}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-experimental_annotation}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 20:14, 21 March 2018
Contents
Reaction NICONUCADENYLYLTRAN-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- Probable nicotinate-nucleotide adenylyltransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ATP[c] + 1 PROTON[c] + 1 NICOTINATE_NUCLEOTIDE[c] => 1 DEAMIDO-NAD[c] + 1 PPI[c]
- With common name(s):
- 1 ATP[c] + 1 H+[c] + 1 β-nicotinate D-ribonucleotide[c] => 1 nicotinate adenine dinucleotide[c] + 1 diphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_6231
- Source: annotation-experimental_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-experimental_annotation
Pathways
- PWY-5381, pyridine nucleotide cycling (plants): PWY-5381
- 3 reactions found over 11 reactions in the full pathway
- PWY-5653, NAD biosynthesis from 2-amino-3-carboxymuconate semialdehyde: PWY-5653
- 3 reactions found over 4 reactions in the full pathway
- PYRIDNUCSYN-PWY, NAD biosynthesis I (from aspartate): PYRIDNUCSYN-PWY
- 3 reactions found over 6 reactions in the full pathway
- PWY-7761, NAD salvage pathway II: PWY-7761
- 1 reactions found over 4 reactions in the full pathway
- PYRIDNUCSAL-PWY, NAD salvage pathway I: PYRIDNUCSAL-PWY
- 1 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
External links