Difference between revisions of "GCLDH"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-CISCIS-MUCONATE 3-HYDROXY-CISCIS-MUCONATE] == * smiles: ** C(=CC(=O)[O-])C(O)=CC(=O)[...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GCLDH GCLDH] == * direction: ** LEFT-TO-RIGHT * common name: ** Glycolate dehydrogenase * Synonym(s...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-CISCIS-MUCONATE 3-HYDROXY-CISCIS-MUCONATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GCLDH GCLDH] ==
* smiles:
+
* direction:
** C(=CC(=O)[O-])C(O)=CC(=O)[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=DLKZGMNZEDNHKO-BXTBVDPRSA-L
+
 
* common name:
 
* common name:
** 3-hydroxy-cis,cis-muconate
+
** Glycolate dehydrogenase
* molecular weight:
+
** 156.095   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1.0 [[GLYCOLLATE]][m] '''+''' 1.0 [[Oxidized-ferredoxins]][m] '''=>''' 1.0 [[GLYOX]][m] '''+''' 1.0 [[Reduced-ferredoxins]][m]
* [[RXN-9922]]
+
* With common name(s):
 +
** 1.0 glycolate[m] '''+''' 1.0 an oxidized ferredoxin [iron-sulfur] cluster[m] '''=>''' 1.0 glyoxylate[m] '''+''' 1.0 a reduced ferredoxin [iron-sulfur] cluster[m]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_6420]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_17319]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54729369 54729369]
+
{{#set: common name=Glycolate dehydrogenase}}
* CHEBI:
+
{{#set: gene associated=Tiso_gene_6420|Tiso_gene_17319}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58139 58139]
+
{{#set: in pathway=}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C03676 C03676]
+
{{#set: reconstruction source=orthology-creinhardtii}}
{{#set: smiles=C(=CC(=O)[O-])C(O)=CC(=O)[O-]}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: inchi key=InChIKey=DLKZGMNZEDNHKO-BXTBVDPRSA-L}}
+
{{#set: common name=3-hydroxy-cis,cis-muconate}}
+
{{#set: molecular weight=156.095    }}
+
{{#set: reversible reaction associated=RXN-9922}}
+

Latest revision as of 20:14, 21 March 2018

Reaction GCLDH

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Glycolate dehydrogenase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 glycolate[m] + 1.0 an oxidized ferredoxin [iron-sulfur] cluster[m] => 1.0 glyoxylate[m] + 1.0 a reduced ferredoxin [iron-sulfur] cluster[m]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links