Difference between revisions of "CPD-7117"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SE-2 SE-2] == * smiles: ** [Se--] * inchi key: ** InChIKey=HMUBNCUQSSTAIB-UHFFFAOYSA-N * common...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7117 CPD-7117] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7117 CPD-7117] == |
* smiles: | * smiles: | ||
| − | ** [ | + | ** C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4))) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** delphinidin-3-O-β-D-glucoside |
| + | * inchi key: | ||
| + | ** InChIKey=XENHPQQLDPAYIJ-PEVLUNPASA-M | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 463.374 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** delfinidin-3-O-glucoside |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-8228]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | * | + | * LIPID_MAPS : LMPK12010278 |
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515359 102515359] |
| − | * | + | * HMDB : HMDB37997 |
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=31463 31463] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles=[ | + | ** [http://www.genome.jp/dbget-bin/www_bget?C12138 C12138] |
| − | {{#set: | + | {{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4)))}} |
| − | {{#set: | + | {{#set: common name=delphinidin-3-O-β-D-glucoside}} |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=XENHPQQLDPAYIJ-PEVLUNPASA-M}} |
| − | {{#set: common name= | + | {{#set: molecular weight=463.374 }} |
| − | {{#set: consumed by= | + | {{#set: common name=delfinidin-3-O-glucoside}} |
| + | {{#set: consumed by=RXN-8228}} | ||
Latest revision as of 20:14, 21 March 2018
Contents
Metabolite CPD-7117
- smiles:
- C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4)))
- common name:
- delphinidin-3-O-β-D-glucoside
- inchi key:
- InChIKey=XENHPQQLDPAYIJ-PEVLUNPASA-M
- molecular weight:
- 463.374
- Synonym(s):
- delfinidin-3-O-glucoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4)))" cannot be used as a page name in this wiki.
