Difference between revisions of "OAAAKGtm"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11520 CPD-11520] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=OAAAKGtm OAAAKGtm] == * direction: ** REVERSIBLE * common name: ** Dicarboxylate/tricarboxylate car...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11520 CPD-11520] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=OAAAKGtm OAAAKGtm] ==
* smiles:
+
* direction:
** CCC=CCC4(C(=O)CCC(CCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
** REVERSIBLE
* inchi key:
+
** InChIKey=YYCCMACTOAJGGW-LHVXMLCWSA-J
+
 
* common name:
 
* common name:
** OPC8-3-ketoacyl-CoA
+
** Dicarboxylate/tricarboxylate carrier (oaa:akg), mitochondrial
* molecular weight:
+
** 1053.904   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-10699]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[2-KETOGLUTARATE]][m] '''+''' 1.0 [[OXALACETIC_ACID]][c] '''<=>''' 1.0 [[OXALACETIC_ACID]][m] '''+''' 1.0 [[2-KETOGLUTARATE]][c]
* [[RXN-10698]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1.0 2-oxoglutarate[m] '''+''' 1.0 oxaloacetate[c] '''<=>''' 1.0 oxaloacetate[m] '''+''' 1.0 2-oxoglutarate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14857]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237200 44237200]
+
{{#set: common name=Dicarboxylate/tricarboxylate carrier (oaa:akg), mitochondrial}}
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
{{#set: gene associated=Tiso_gene_14857}}
{{#set: inchi key=InChIKey=YYCCMACTOAJGGW-LHVXMLCWSA-J}}
+
{{#set: in pathway=}}
{{#set: common name=OPC8-3-ketoacyl-CoA}}
+
{{#set: reconstruction category=orthology}}
{{#set: molecular weight=1053.904    }}
+
{{#set: reconstruction source=orthology-creinhardtii}}
{{#set: consumed by=RXN-10699}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: produced by=RXN-10698}}
+

Latest revision as of 20:14, 21 March 2018

Reaction OAAAKGtm

  • direction:
    • REVERSIBLE
  • common name:
    • Dicarboxylate/tricarboxylate carrier (oaa:akg), mitochondrial
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links