Difference between revisions of "RXN-9558"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=APIGENIN APIGENIN] == * smiles: ** C2(C(C=CC(C1(C(=CC(=CC(O)=1)O)O))=O)=CC=C(C=2)O) * inchi key...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9558 RXN-9558] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=APIGENIN APIGENIN] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9558 RXN-9558] ==
−
* smiles:
+
* direction:
−
** C2(C(C=CC(C1(C(=CC(=CC(O)=1)O)O))=O)=CC=C(C=2)O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=YQHMWTPYORBCMF-ZZXKWVIFSA-N
+
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
−
* common name:
+
−
** 2',4,4',6'-tetrahydroxychalcone
+
−
* molecular weight:
+
−
** 272.257   
+
 
* Synonym(s):
 
* Synonym(s):
−
** naringenin chalcone
 
−
** chalconaringenin
 
−
** 2'4'6'4-Tetrahydroxychalcone
 
−
** Isosalipurpol
 
−
** tetrahydroxychalcone
 
−
** 3-(4-hydroxyphemyl)-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[APIGNAR-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[cis-vaccen-2-enoyl-ACPs]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[Cis-vaccenoyl-ACPs]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NADH[c] '''+''' 1 H+[c] '''+''' 1 a (2-trans-11-cis)-vaccen-2-enoyl-[acp][c] '''=>''' 1 NAD+[c] '''+''' 1 a cis-vaccenoyl-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_10778]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5973]], cis-vaccenate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5973 PWY-5973]
 +
** '''4''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 73692-50-9
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* LIPID_MAPS : LMPK12120264
+
{{#set: ec number=EC-1.3.1.9}}
−
* PUBCHEM:
+
{{#set: gene associated=Tiso_gene_10778}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280960 5280960]
+
{{#set: in pathway=PWY-5973}}
−
* HMDB : HMDB29631
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06561 C06561]
+
{{#set: reconstruction tool=pantograph}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.4444447.html 4444447]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15413 15413]
+
−
* METABOLIGHTS : MTBLC15413
+
−
{{#set: smiles=C2(C(C=CC(C1(C(=CC(=CC(O)=1)O)O))=O)=CC=C(C=2)O)}}
+
−
{{#set: inchi key=InChIKey=YQHMWTPYORBCMF-ZZXKWVIFSA-N}}
+
−
{{#set: common name=2',4,4',6'-tetrahydroxychalcone}}
+
−
{{#set: molecular weight=272.257    }}
+
−
{{#set: common name=naringenin chalcone|chalconaringenin|2'4'6'4-Tetrahydroxychalcone|Isosalipurpol|tetrahydroxychalcone|3-(4-hydroxyphemyl)-1-(2,4,6-trihydroxyphenyl)prop-2-en-1-one}}
+
−
{{#set: consumed by=APIGNAR-RXN}}
+

Latest revision as of 20:14, 21 March 2018

Reaction RXN-9558

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5973, cis-vaccenate biosynthesis: PWY-5973
    • 4 reactions found over 5 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-9558&oldid=47063"