Difference between revisions of "CPD-19490"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D11-23-3-hydroxyC42-2-ACPs cis-cis-D11-23-3-hydroxyC42-2-ACPs] == * common name: ** a c...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19490 CPD-19490] == * smiles: ** CSCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * common name: ** 3-isopr...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D11-23-3-hydroxyC42-2-ACPs cis-cis-D11-23-3-hydroxyC42-2-ACPs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19490 CPD-19490] ==
 +
* smiles:
 +
** CSCCCCC(C(=O)C(=O)[O-])C(=O)[O-]
 
* common name:
 
* common name:
** a cis,cis-delta11,23-3-hydroxyC42:2-[acp]
+
** 3-isopropyl-7-(methylthio)-2-oxoheptanoate
 +
* inchi key:
 +
** InChIKey=XXJZWLKRFPCKLB-UHFFFAOYSA-L
 +
* molecular weight:
 +
** 232.251   
 
* Synonym(s):
 
* Synonym(s):
** a cis,cis-delta 11,23-3-hydroxy C42:2-[acyl-carrier-protein]
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-18207]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1G-637]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-18206]]
 
== External links  ==
 
== External links  ==
{{#set: common name=a cis,cis-delta11,23-3-hydroxyC42:2-[acp]}}
+
{{#set: smiles=CSCCCCC(C(=O)C(=O)[O-])C(=O)[O-]}}
{{#set: common name=a cis,cis-delta 11,23-3-hydroxy C42:2-[acyl-carrier-protein]}}
+
{{#set: common name=3-isopropyl-7-(methylthio)-2-oxoheptanoate}}
{{#set: produced by=RXN1G-637}}
+
{{#set: inchi key=InChIKey=XXJZWLKRFPCKLB-UHFFFAOYSA-L}}
 +
{{#set: molecular weight=232.251    }}
 +
{{#set: consumed by=RXN-18207}}
 +
{{#set: reversible reaction associated=RXN-18206}}

Latest revision as of 20:14, 21 March 2018

Metabolite CPD-19490

  • smiles:
    • CSCCCCC(C(=O)C(=O)[O-])C(=O)[O-]
  • common name:
    • 3-isopropyl-7-(methylthio)-2-oxoheptanoate
  • inchi key:
    • InChIKey=XXJZWLKRFPCKLB-UHFFFAOYSA-L
  • molecular weight:
    • 232.251
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CSCCCCC(C(=O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.