Difference between revisions of "Tiso gene 9503"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-D-GALACTO-14-FURANOSE UDP-D-GALACTO-14-FURANOSE] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])...")
(Created page with "Category:Gene == Gene Tiso_gene_9503 == * right end position: ** 3786 * transcription direction: ** POSITIVE * left end position: ** 1799 * centisome position: ** 19.3816...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-D-GALACTO-14-FURANOSE UDP-D-GALACTO-14-FURANOSE] ==
+
== Gene Tiso_gene_9503 ==
−
* smiles:
+
* right end position:
−
** C(OP(=O)([O-])OP(=O)([O-])OC1(O[CH](C(O)CO)C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3))
+
** 3786
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZQLQOXLUCGXKHS-SIAUPFDVSA-L
+
** POSITIVE
−
* common name:
+
* left end position:
−
** UDP-α-D-galactofuranose
+
** 1799
−
* molecular weight:
+
* centisome position:
−
** 564.289    
+
** 19.3816    
 
* Synonym(s):
 
* Synonym(s):
−
** UDP-Galf
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[GALPMUT-RXN]]
+
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-17678]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-600]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-7784]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-5152]]
 +
* [[PWY1F-823]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=3786}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244316 25244316]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=1799}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=66915 66915]
+
{{#set: centisome position=19.3816   }}
−
* BIGG : udpgalfur
+
{{#set: reaction associated=DIHYDROKAEMPFEROL-4-REDUCTASE-RXN|RXN-17678|RXN-600|RXN-7784}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-5152|PWY1F-823}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03733 C03733]
+
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OC1(O[CH](C(O)CO)C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3))}}
+
−
{{#set: inchi key=InChIKey=ZQLQOXLUCGXKHS-SIAUPFDVSA-L}}
+
−
{{#set: common name=UDP-α-D-galactofuranose}}
+
−
{{#set: molecular weight=564.289   }}
+
−
{{#set: common name=UDP-Galf}}
+
−
{{#set: reversible reaction associated=GALPMUT-RXN}}
+

Latest revision as of 20:14, 21 March 2018

Gene Tiso_gene_9503

  • right end position:
    • 3786
  • transcription direction:
    • POSITIVE
  • left end position:
    • 1799
  • centisome position:
    • 19.3816
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9503&oldid=47082"