Difference between revisions of "CPD0-1812"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14950 CPD-14950] == * smiles: ** COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3)) * i...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1812 CPD0-1812] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OC(CO)CO * common name: ** 2-oleoyl...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1812 CPD0-1812] == |
* smiles: | * smiles: | ||
− | ** | + | ** CCCCCCCCC=CCCCCCCCC(=O)OC(CO)CO |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 2-oleoylglycerol |
+ | * inchi key: | ||
+ | ** InChIKey=UPWGQKDVAURUGE-KTKRTIGZSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 356.545 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2-mono-C18:1 |
− | ** | + | ** 2-monoolein |
− | ** | + | ** 2-monooleoylglycerol |
− | ** 3- | + | ** 2-glyceryl monooleate |
+ | ** 1,3-dihydroxypropan-2-yl oleate | ||
+ | ** 2-(9Z)-octadecenoylglycerol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-15088]] | ||
+ | * [[RXN-15091]] | ||
+ | * [[RXN-15090]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * LIPID_MAPS : LMGL01010024 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5319879 5319879] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73990 73990] |
− | * | + | * METABOLIGHTS : MTBLC73990 |
− | * | + | * HMDB : HMDB11537 |
− | {{#set: smiles= | + | {{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)OC(CO)CO}} |
− | {{#set: | + | {{#set: common name=2-oleoylglycerol}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=UPWGQKDVAURUGE-KTKRTIGZSA-N}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=356.545 }} |
− | {{#set: common name= | + | {{#set: common name=2-mono-C18:1|2-monoolein|2-monooleoylglycerol|2-glyceryl monooleate|1,3-dihydroxypropan-2-yl oleate|2-(9Z)-octadecenoylglycerol}} |
− | {{#set: | + | {{#set: consumed by=RXN-15088|RXN-15091|RXN-15090}} |
Latest revision as of 21:14, 21 March 2018
Contents
Metabolite CPD0-1812
- smiles:
- CCCCCCCCC=CCCCCCCCC(=O)OC(CO)CO
- common name:
- 2-oleoylglycerol
- inchi key:
- InChIKey=UPWGQKDVAURUGE-KTKRTIGZSA-N
- molecular weight:
- 356.545
- Synonym(s):
- 2-mono-C18:1
- 2-monoolein
- 2-monooleoylglycerol
- 2-glyceryl monooleate
- 1,3-dihydroxypropan-2-yl oleate
- 2-(9Z)-octadecenoylglycerol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links