Difference between revisions of "HOMO-SER"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_4002 == * left end position: ** 6659 * transcription direction: ** NEGATIVE * right end position: ** 8580 * centisome position: ** 42.62305...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-SER HOMO-SER] == * smiles: ** C(CO)C([N+])C([O-])=O * common name: ** L-homoserine * inchi...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-SER HOMO-SER] == |
− | * | + | * smiles: |
− | ** | + | ** C(CO)C([N+])C([O-])=O |
− | * | + | * common name: |
− | ** | + | ** L-homoserine |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=UKAUYVFTDYCKQA-VKHMYHEASA-N |
− | * | + | * molecular weight: |
− | ** | + | ** 119.12 |
* Synonym(s): | * Synonym(s): | ||
+ | ** homo-ser | ||
+ | ** homoserine | ||
+ | ** 2-amino-4-hydroxybutanoic acid | ||
+ | ** 2-amino-4-hydroxybutanoate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[HOMOSERDEAM-RXN]] |
− | * | + | * [[HOMOSERKIN-RXN]] |
− | + | * [[RXN-14049]] | |
− | * [[RXN- | + | == Reaction(s) known to produce the compound == |
− | + | * [[HOMOSERDEHYDROG-RXN]] | |
− | * | + | * [[R01775]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | * [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]] | |
− | + | ||
− | == | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 672-15-1 |
− | {{#set: | + | * BIGG : hom__L |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971022 6971022] |
− | {{#set: | + | * HMDB : HMDB00719 |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00263 C00263] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57476 57476] | ||
+ | * METABOLIGHTS : MTBLC57476 | ||
+ | {{#set: smiles=C(CO)C([N+])C([O-])=O}} | ||
+ | {{#set: common name=L-homoserine}} | ||
+ | {{#set: inchi key=InChIKey=UKAUYVFTDYCKQA-VKHMYHEASA-N}} | ||
+ | {{#set: molecular weight=119.12 }} | ||
+ | {{#set: common name=homo-ser|homoserine|2-amino-4-hydroxybutanoic acid|2-amino-4-hydroxybutanoate}} | ||
+ | {{#set: consumed by=HOMOSERDEAM-RXN|HOMOSERKIN-RXN|RXN-14049}} | ||
+ | {{#set: produced by=HOMOSERDEHYDROG-RXN|R01775}} | ||
+ | {{#set: reversible reaction associated=HOMOSERINE-O-ACETYLTRANSFERASE-RXN}} |
Latest revision as of 19:30, 21 March 2018
Contents
Metabolite HOMO-SER
- smiles:
- C(CO)C([N+])C([O-])=O
- common name:
- L-homoserine
- inchi key:
- InChIKey=UKAUYVFTDYCKQA-VKHMYHEASA-N
- molecular weight:
- 119.12
- Synonym(s):
- homo-ser
- homoserine
- 2-amino-4-hydroxybutanoic acid
- 2-amino-4-hydroxybutanoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 672-15-1
- BIGG : hom__L
- PUBCHEM:
- HMDB : HMDB00719
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57476
"C(CO)C([N+])C([O-])=O" cannot be used as a page name in this wiki.