Difference between revisions of "ALLO-THR"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=KDO-8P KDO-8P] == * smiles: ** C(OP([O-])(=O)[O-])C(O)[CH]1(OC(O)(C([O-])=O)CC(C1O)O) * inchi k...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLO-THR ALLO-THR] == * common name: ** DL-allothreonine * Synonym(s): ** allothreonine ** allo...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLO-THR ALLO-THR] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** DL-allothreonine |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** allothreonine |
| − | + | ** allo-thr | |
| − | + | ||
| − | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN0-5234]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=DL-allothreonine}} | |
| − | + | {{#set: common name=allothreonine|allo-thr}} | |
| − | + | {{#set: consumed by=RXN0-5234}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
Latest revision as of 20:14, 21 March 2018
Contents
Metabolite ALLO-THR
- common name:
- DL-allothreonine
- Synonym(s):
- allothreonine
- allo-thr
