Difference between revisions of "Tiso gene 14707"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15685 CPD-15685] == * smiles: ** CCCCCCC=CC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...")
(Created page with "Category:Gene == Gene Tiso_gene_14707 == * Synonym(s): == Reactions associated == * Reaction: 1.14.11.18-RXN ** Source: orthology-esiliculosus * Reaction: RXN66...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15685 CPD-15685] ==
+
== Gene Tiso_gene_14707 ==
* smiles:
+
** CCCCCCC=CC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=XPVHXTGUZGACRU-MCFMHTHASA-J
+
* common name:
+
** 2-trans, 5-cis, 7-trans-tetradecatrienoyl-CoA
+
* molecular weight:
+
** 967.814   
+
 
* Synonym(s):
 
* Synonym(s):
** 2E, 5Z, 7E-tetradecatrienoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[1.14.11.18-RXN]]
* [[RXN-14796]]
+
** Source: [[orthology-esiliculosus]]
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN66-470]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY66-387]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=1.14.11.18-RXN|RXN66-470}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657959 90657959]
+
{{#set: pathway associated=PWY66-387}}
{{#set: smiles=CCCCCCC=CC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=XPVHXTGUZGACRU-MCFMHTHASA-J}}
+
{{#set: common name=2-trans, 5-cis, 7-trans-tetradecatrienoyl-CoA}}
+
{{#set: molecular weight=967.814    }}
+
{{#set: common name=2E, 5Z, 7E-tetradecatrienoyl-CoA}}
+
{{#set: produced by=RXN-14796}}
+

Latest revision as of 20:14, 21 March 2018

Gene Tiso_gene_14707

  • Synonym(s):

Reactions associated

Pathways associated

External links