Difference between revisions of "Tiso gene 10055"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCYL-PEPTIDE GLYCYL-PEPTIDE] == * smiles: ** C(C(NC(C(O)=O)[R])=O)N * common name: ** glycyl-...")
 
(Created page with "Category:Gene == Gene Tiso_gene_10055 == * Synonym(s): == Reactions associated == * Reaction: ADENOSINETRIPHOSPHATASE-RXN ** Source: orthology-esiliculosus == Pat...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCYL-PEPTIDE GLYCYL-PEPTIDE] ==
+
== Gene Tiso_gene_10055 ==
* smiles:
+
** C(C(NC(C(O)=O)[R])=O)N
+
* common name:
+
** glycyl-peptide
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ADENOSINETRIPHOSPHATASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-esiliculosus]]
* [[2.3.1.97-RXN]]
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: reaction associated=ADENOSINETRIPHOSPHATASE-RXN}}
** [http://www.genome.jp/dbget-bin/www_bget?C02038 C02038]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16462 16462]
+
{{#set: smiles=C(C(NC(C(O)=O)[R])=O)N}}
+
{{#set: common name=glycyl-peptide}}
+
{{#set: consumed or produced by=2.3.1.97-RXN}}
+

Latest revision as of 19:30, 21 March 2018

Gene Tiso_gene_10055

  • Synonym(s):

Reactions associated

Pathways associated

External links