Difference between revisions of "Tiso gene 6640"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SPERMINE SPERMINE] == * smiles: ** C(CCC[N+]CCC[N+])[N+]CCC[N+] * inchi key: ** InChIKey=PFNFFQ...") |
(Created page with "Category:Gene == Gene Tiso_gene_6640 == * Synonym(s): == Reactions associated == * Reaction: 5-NUCLEOTID-RXN ** Source: orthology-esiliculosus * Reaction: AMP-D...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_6640 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[5-NUCLEOTID-RXN]] | |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | == | + | * Reaction: [[AMP-DEPHOSPHORYLATION-RXN]] |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-14025]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-14026]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-14227]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-5841]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-7607]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-7609]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[XMPXAN-RXN]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5381]] | ||
+ | * [[PWY-6607]] | ||
+ | * [[PWY-7185]] | ||
+ | * [[PWY-7821]] | ||
+ | * [[SALVADEHYPOX-PWY]] | ||
+ | * [[PWY-6596]] | ||
+ | * [[NAD-BIOSYNTHESIS-II]] | ||
+ | * [[PWY-6606]] | ||
+ | * [[PWY-6608]] | ||
+ | * [[PWY-5695]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=5-NUCLEOTID-RXN|AMP-DEPHOSPHORYLATION-RXN|RXN-14025|RXN-14026|RXN-14227|RXN-5841|RXN-7607|RXN-7609|XMPXAN-RXN}} | |
− | + | {{#set: pathway associated=PWY-5381|PWY-6607|PWY-7185|PWY-7821|SALVADEHYPOX-PWY|PWY-6596|NAD-BIOSYNTHESIS-II|PWY-6606|PWY-6608|PWY-5695}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Latest revision as of 20:14, 21 March 2018
Gene Tiso_gene_6640
- Synonym(s):
Reactions associated
- Reaction: 5-NUCLEOTID-RXN
- Source: orthology-esiliculosus
- Reaction: AMP-DEPHOSPHORYLATION-RXN
- Source: orthology-esiliculosus
- Reaction: RXN-14025
- Source: orthology-esiliculosus
- Reaction: RXN-14026
- Source: orthology-esiliculosus
- Reaction: RXN-14227
- Source: orthology-esiliculosus
- Reaction: RXN-5841
- Source: orthology-esiliculosus
- Reaction: RXN-7607
- Source: orthology-esiliculosus
- Reaction: RXN-7609
- Source: orthology-esiliculosus
- Reaction: XMPXAN-RXN
- Source: orthology-esiliculosus
Pathways associated
- PWY-5381
- PWY-6607
- PWY-7185
- PWY-7821
- SALVADEHYPOX-PWY
- PWY-6596
- NAD-BIOSYNTHESIS-II
- PWY-6606
- PWY-6608
- PWY-5695